Compound Description
| ID: C0803 | Common name: Apicidin |
| IUPAC: (3S,6S,9S,12R)-3-[(2S)-butan-2-yl]-6-[(1-methoxyindol-3-yl)methyl]-9-(6-oxooctyl)-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone | CAS: CAS:183506-66-3 |
| Chembl ID: CHEMBL430060 | Pubchem ID: CID:6918328 |
| Formula: C34H49N5O6 | TCM-ID: TCMC5174 |
| Smiles: CCC(=O)CCCCC[C@@H]1NC(=O)[C@H]2CCCCN2C(=O)[C@@H](NC(=O)[C@@H](NC1=O)Cc1cn(c2c1cccc2)OC)[C@H](CC)C | |
| Alias:
Cyclo(8-oxo-L-2-aminodecanoyl-1-methoxy-L-tryptophyl-L-isoleucyl-D-2-piperidinecarbonyl);
Apicidin; Apicidin Ia; OSI 2040 |
Structure:
|
Related Targets (Total: 4)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T68DAN | Histone deacetylase 9 | HDAC9 |
Q9UKV0 |
A | 3 Reference(s) |
| T68M1D | Histone deacetylase 2 | HDAC2 |
Q92769 |
A | 1 Reference(s) |
| T38AWT | Histone deacetylase 3 | HDAC3 |
O15379 |
A | 2 Reference(s) |
| T50FPV | Interleukin-7 receptor subunit alpha | IL7R |
P16871 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0794 | Zhe Bei Mu | 浙贝母 | Thunberg fritillary | Fritillaria verticillata var. thunbergii |
Ckey description of the interaction between compound and target