Compound Description
| ID: C0810 | Common name: Ginsenoside Rb1 |
| IUPAC: (2R,3R,4S,5S,6R)-2-[[(2R,3S,4S,5R,6S)-6-[(2S)-2-[(3S,5R,8R,9R,10R,12R,13R,14R,17S)-3-[(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-12-hydroxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methylhept-5-en-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol | CAS: CAS:41753-43-9 |
| Chembl ID: CHEMBL501515 | Pubchem ID: CID:9898279 |
| Formula: C54H92O23 | TCM-ID: TCMC5255 |
| Smiles: OC[C@H]1O[C@@H](O[C@H]2CC[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3C[C@@H](O)[C@H]3[C@@]2(C)CC[C@@H]3[C@@](O[C@@H]2O[C@H](CO[C@@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O)[C@H]([C@@H]([C@H]2O)O)O)(CCC=C(C)C)C)C)C)[C@@H]([C@H]([C@@H]1O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O | |
| Alias:
(3β,12β)-20-[(6-O-β-D-Glucopyranosyl-β-D-glucopyranosyl)oxy]-12-hydroxydammar-24-en-3-yl 2-O-β-D-glucopyranosyl-β-D-glucopyranoside;
Dammarane, β-D-glucopyranoside deriv.; Arasaponin E1; Ginsenoside Rb1; Gynosaponin C; Gypenoside III; NSC 310103; Notoginsenoside Rb1; Panaxoside Rb1; Sanchinoside E1; Sanchinoside Rb1 |
Structure:
|
Related Targets (Total: 6)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T16MRU | NACHT, LRR and PYD domains-containing protein 3 | NLRP3 |
Q96P20 |
A | 1 Reference(s) |
| T27F5B | Interleukin-1 receptor-associated kinase 1 | IRAK1 |
P51617 |
A | 1 Reference(s) |
| T04WT7 | Fibronectin | FN1 |
P02751 |
C | 2 Reference(s) |
| T82ALJ | Glycogen synthase kinase-3 beta | GSK3B |
P49841 |
C | 1 Reference(s) |
| T20VPX | Cyclin-dependent-like kinase 5 | CDK5 |
Q00535 |
C | 1 Reference(s) |
| T83QHM | Beta-nerve growth factor | NGF |
P01138 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 4)
Ckey description of the interaction between compound and target