Compound Description
| ID: C0827 | Common name: 7,8-Dihydroxyflavone |
| IUPAC: 7,8-dihydroxy-2-phenylchromen-4-one | CAS: CAS:38183-03-8 |
| Chembl ID: CHEMBL75267 | Pubchem ID: CID:1880 |
| Formula: C15H10O4 | TCM-ID: TCMC582 |
| Smiles: Oc1ccc2c(c1O)oc(cc2=O)c1ccccc1 | |
| Alias:
Flavone, 7,8-dihydroxy-;
7,8-Dihydroxy-2-phenyl-4H-1-benzopyran-4-one; 7,8-Dihydroxy-2-phenyl-4H-chromen-4-one; 7,8-Dihydroxyflavone |
Structure:
|
Related Targets (Total: 4)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T07S0E | BDNF/NT-3 growth factors receptor | NTRK2 |
Q16620 |
A | 11 Reference(s) |
| T75OVL | High affinity nerve growth factor receptor | NTRK1 |
P04629 |
A | 1 Reference(s) |
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
B | 1 Reference(s) |
| T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
B | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target