Compound Description
| ID: C0830 | Common name: 7-Oxocholesterol |
| IUPAC: (3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-7-one | CAS: CAS:566-28-9 |
| Chembl ID: CHEMBL1278177 | Pubchem ID: CID:91474 |
| Formula: C27H44O2 | TCM-ID: TCMC588 |
| Smiles: CC(CCC[C@H]([C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2C(=O)C=C2[C@]1(C)CC[C@@H](C2)O)C)C | |
| Alias:
Cholest-5-en-7-one, 3β-hydroxy-;
(3β)-3-Hydroxycholest-5-en-7-one; 3β-Hydroxy-cholest-5-ene-7-one; 3β-Hydroxycholest-5-en-7-one; 7-Ketocholesterol; 7-Oxocholesterol; Cholest-5-en-3β-ol-7-one; SC 4722; Δ5-Cholesten-3β-ol-7-one |
Structure:
|
Related Targets (Total: 11)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T38T1U | Caspase-8 | CASP8 |
Q14790 |
A | 1 Reference(s) |
| T23P74 | Caspase-9 | CASP9 |
P55211 |
A | 1 Reference(s) |
| T13YN2 | Bcl-2-like protein 1 | Bcl2l1 |
Q64373 |
C | 1 Reference(s) |
| T73LPO | Poly [ADP-ribose] polymerase 1 | PARP1 |
P09874 |
C | 1 Reference(s) |
| T90ADC | BH3-interacting domain death agonist | BID |
P55957 |
C | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 1 Reference(s) |
| T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
C | 1 Reference(s) |
| T82JWE | Cellular tumor antigen p53 | TP53 |
P04637 |
C | 1 Reference(s) |
| T84AR4 | Smoothened homolog | SMO |
Q99835 |
C | 1 Reference(s) |
| T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
C | 1 Reference(s) |
| T95EK6 | Microtubule-associated proteins 1A/1B light chain 3B | MAP1LC3B |
Q9GZQ8 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target