Compound Description
| ID: C0925 | Common name: Arundine |
| IUPAC: 3-(1H-indol-3-ylmethyl)-1H-indole | CAS: CAS:1968-05-4 |
| Chembl ID: CHEMBL446452 | Pubchem ID: CID:3071 |
| Formula: C17H14N2 | TCM-ID: TCMC728 |
| Smiles: c1ccc2c(c1)c(c[nH]2)Cc1c[nH]c2c1cccc2 | |
| Alias:
Indole, 3,3'-methylenedi-;
3,3'-Methylenebis[1H-indole]; 3,3'-Bisindolylmethane; 3,3'-Diindolylmethane; Arundine; Bis(1H-indol-3-yl)methane; Bis(3-indolyl)methane; Cervicon-DIM; DIM; DIM (AhR agonist); DIM (diindolylmethane); Diindolylmethane; HB 236; Infemin |
Structure:
|
Related Targets (Total: 22)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
A | 2 Reference(s) |
| T29MD1 | Mitogen-activated protein kinase 8 | MAPK8 |
P45983 |
A | 1 Reference(s) |
| T03G09 | Tumor necrosis factor ligand superfamily member 11 | TNFSF11 |
O14788 |
A | 1 Reference(s) |
| T25C2G | Nuclear receptor subfamily 4 group A member 1 | NR4A1 |
P22736 |
A | 2 Reference(s) |
| T06RMZ | Nuclear factor NF-kappa-B p105 subunit | NFKB1 |
P19838 |
A | 1 Reference(s) |
| T25NSJ | Mitogen-activated protein kinase 3 | MAPK3 |
P27361 |
A | 1 Reference(s) |
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
A | 1 Reference(s) |
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
A | 2 Reference(s) |
| T71BDH | Mitogen-activated protein kinase 14 | MAPK14 |
Q16539 |
A | 1 Reference(s) |
| T00CXT | Prostaglandin G/H synthase 1 | PTGS1 |
P23219 |
A | 1 Reference(s) |
| T89IFP | G-protein coupled receptor 84 | GPR84 |
Q9NQS5 |
A | 1 Reference(s) |
| T75PC7 | NA | MIR21 |
NA |
A | 2 Reference(s) |
| T22OPB | Nuclear factor erythroid 2-related factor 2 | NFE2L2 |
Q16236 |
B | 1 Reference(s) |
| T84W8G | Aryl hydrocarbon receptor | AHR |
P35869 |
B | 1 Reference(s) |
| T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
C | 1 Reference(s) |
| T47WT6 | Breast cancer type 1 susceptibility protein | BRCA1 |
P38398 |
C | 4 Reference(s) |
| T59IKQ | Vascular cell adhesion protein 1 | VCAM1 |
P19320 |
C | 1 Reference(s) |
| T93WZG | G1/S-specific cyclin-D1 | CCND1 |
P24385 |
C | 1 Reference(s) |
| T96C0N | NA | MIR221 |
NA |
C | 1 Reference(s) |
| T64X48 | C-X-C chemokine receptor type 4 | CXCR4 |
P61073 |
C | 1 Reference(s) |
| T78IOY | Telomerase reverse transcriptase | TERT |
O14746 |
C | 1 Reference(s) |
| T40XWM | Proto-oncogene tyrosine-protein kinase ROS | ROS1 |
P08922 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0180 | Lu Zhu Gen | 芦竹根 | Giantreed rhizome | Arundo donax |
Ckey description of the interaction between compound and target