Compound Description
| ID: C0942 | Common name: selenocystine |
| IUPAC: 2-amino-3-(2-amino-3-hydroxy-3-oxopropyl)diselanylpropanoic acid | CAS: CAS:2897-21-4 |
| Chembl ID: NA | Pubchem ID: CID:15104 |
| Formula: C6H12N2O4Se2 | TCM-ID: TCMC7386 |
| Smiles: C(C(C(=O)O)N)[Se][Se]CC(C(=O)O)N | |
| Alias:
Alanine, 3,3'-diselenodi-, DL- (8CI);
DL-Alanine, 3,3'-diselenobis-; DL-Selenocystine; Seleno-DL-cystine; Selenocystine |
Structure:
|
Related Targets (Total: 9)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
B | 1 Reference(s) |
| T10S5F | Cyclin-dependent kinase 4 | CDK4 |
P11802 |
C | 1 Reference(s) |
| T22IMH | Cyclin-dependent kinase 6 | CDK6 |
Q00534 |
C | 1 Reference(s) |
| T64W2K | Cyclin-dependent kinase inhibitor 1 | CDKN1A |
P38936 |
C | 1 Reference(s) |
| T82JWE | Cellular tumor antigen p53 | TP53 |
P04637 |
C | 1 Reference(s) |
| T86UXL | Cyclin-A2 | CCNA2 |
P20248 |
C | 1 Reference(s) |
| T93WZG | G1/S-specific cyclin-D1 | CCND1 |
P24385 |
C | 1 Reference(s) |
| T95QJ9 | G1/S-specific cyclin-D3 | CCND3 |
P30281 |
C | 1 Reference(s) |
| T02IOG | Cyclin-dependent kinase inhibitor 1B | CDKN1B |
P46527 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target