Compound Description
| ID: C0946 | Common name: beta-hydroxyisovalerylshikonin |
| IUPAC: [1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 3-hydroxy-3-methylbutanoate | CAS: CAS:7415-78-3 |
| Chembl ID: NA | Pubchem ID: CID:100203 |
| Formula: C21H24O7 | TCM-ID: TCMC7390 |
| Smiles: CC(=CCC(C1=CC(=O)C2=C(C=CC(=C2C1=O)O)O)OC(=O)CC(C)(C)O)C | |
| Alias:
Butanoic acid, 3-hydroxy-3-methyl-, (1R)-1-(1,4-dihydro-5,8-dihydroxy-1,4-dioxo-2-naphthalenyl)-4-methyl-3-pentenyl ester (9CI);
Butanoic acid, 3-hydroxy-3-methyl-, 1-(1,4-dihydro-5,8-dihydroxy-1,4-dioxo-2-naphthalenyl)-4-methyl-3-pentenyl ester, (R)-; Butyric acid, 3-hydroxy-3-methyl-, 2-ester with 5,8-dihydroxy-2-(1-hydroxy-4-methyl-3-pentenyl)-1,4-naphthoquinone, (+)- (8CI); NSC 110263; beta-HIVS; beta-Hydroxyisovalerylshikonin |
Structure:
|
Related Targets (Total: 7)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T43N2D | Epidermal growth factor receptor | EGFR |
P00533 |
A | 1 Reference(s) |
| T95B1B | Deoxyuridine 5'-triphosphate nucleotidohydrolase, mitochondrial | DUT |
P33316 |
B | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
B | 2 Reference(s) |
| T38T1U | Caspase-8 | CASP8 |
Q14790 |
B | 1 Reference(s) |
| T23P74 | Caspase-9 | CASP9 |
P55211 |
B | 1 Reference(s) |
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
B | 1 Reference(s) |
| T04A2Q | Serine/threonine-protein kinase PLK1 | PLK1 |
P53350 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target