Compound Description
| ID: C0972 | Common name: digoxin |
| IUPAC: 3-[(3S,5R,8R,9S,10S,12R,13S,14S)-3-[(2R,4S,5S,6R)-5-[(2S,4S,5S,6R)-5-[(2S,4S,5S,6R)-4,5-dihydroxy-6-methyloxan-2-yl]oxy-4-hydroxy-6-methyloxan-2-yl]oxy-4-hydroxy-6-methyloxan-2-yl]oxy-12,14-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2H-furan-5-one | CAS: CAS:20830-75-5 |
| Chembl ID: CHEMBL49693 | Pubchem ID: CID:30322 |
| Formula: C41H64O14 | TCM-ID: TCMC7415 |
| Smiles: CC1C(C(CC(O1)OC2C(OC(CC2O)OC3C(OC(CC3O)OC4CCC5(C(C4)CCC6C5CC(C7(C6(CCC7C8=CC(=O)OC8)O)C)O)C)C)C)O)O | |
| Alias:
Digitoxin, 12beta-hydroxy- (6CI);
Digoxin (8CI); 12beta-Hydroxydigitoxin; Cardigox; Cardiogoxin; Cardioxin; Cardixin; Cardoxin; Chloroformic digitalin; Coragoxine; Cordioxil; Davoxin; Digacin; Digicor; Digomal; Digon; Digosin; Digoxin Nativelle; Digoxine; Dilanacin; Dixina; Dokim; Dynamos; Eudigox; Fargoxin; Grexin; Homolle's digitalin; Lanacordin; Lanacrist; Lanicor; Lanikor; Lanocardin; Lanorale; Lanoxicaps; Lanoxin; Lanoxin PG; Lenoxicaps; Lenoxin; Longdigox; Mapluxin; NSC 95100; Natigoxin; NeoDioxanin; Novodigal-Amp.; Purgoxin; Rougoxin; Stillacor; Toloxin; Vanoxin |
Structure:
|
Related Targets (Total: 7)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T38WWN | Serum paraoxonase/arylesterase 1 | PON1 |
P27169 |
A | 1 Reference(s) |
| T10HXK | Cytochrome P450 11B1, mitochondrial | CYP11B1 |
P15538 |
A | 1 Reference(s) |
| T88AJI | Hypoxia-inducible factor 1-alpha | HIF1A |
Q16665 |
B | 1 Reference(s) |
| T55TEP | Steroidogenic acute regulatory protein, mitochondrial | STAR |
P49675 |
B | 1 Reference(s) |
| T85S9Z | Cholesterol side-chain cleavage enzyme, mitochondrial | CYP11A1 |
P05108 |
B | 1 Reference(s) |
| T50WOV | ATP-dependent translocase ABCB1 | ABCB1 |
P08183 |
B | 3 Reference(s) |
| T50SX0 | Nuclear receptor subfamily 1 group I member 2 | NR1I2 |
O75469 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target