Compound Description
| ID: C1099 | Common name: matrine |
| IUPAC: NA | CAS: CAS:519-02-8 |
| Chembl ID: CHEMBL1733145 | Pubchem ID: CID:285698 |
| Formula: C15H24N2O | TCM-ID: TCMC7536 |
| Smiles: C1CC2C3CCCN4C3C(CCC4)CN2C(=O)C1 | |
| Alias:
Matridin-15-one;
Matrine (6CI,7CI,8CI); (+)-Matrine; NSC 146051; NSC 318810; Vegard; alpha-Matrine |
Structure:
|
Related Targets (Total: 10)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T20JZ2 | Androgen receptor | AR |
P10275 |
B | 1 Reference(s) |
| T23VMI | Tumor necrosis factor | TNF |
P01375 |
B | 1 Reference(s) |
| T33OPP | Interleukin-6 | IL6 |
P05231 |
B | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
B | 2 Reference(s) |
| T14Q85 | Heparanase | HPSE |
Q9Y251 |
B | 1 Reference(s) |
| T06JXV | CD44 antigen | CD44 |
P16070 |
B | 2 Reference(s) |
| T10HL8 | Intercellular adhesion molecule 1 | ICAM1 |
P05362 |
B | 1 Reference(s) |
| T80GUN | 72 kDa type IV collagenase | MMP2 |
P08253 |
B | 1 Reference(s) |
| T31N5W | Immediate early response 3-interacting protein 1 | IER3IP1 |
Q9Y5U9 |
C | 1 Reference(s) |
| T26EZU | Myc proto-oncogene protein | MYC |
P01106 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target