Compound Description
| ID: C1103 | Common name: Baccharin |
| IUPAC: (E)-3-[3-(3-methylbut-2-enyl)-4-(3-phenylpropanoyloxy)phenyl]prop-2-enoic acid | CAS: CAS:107389-85-5 |
| Chembl ID: CHEMBL511708 | Pubchem ID: CID:9947201 |
| Formula: C23H24O4 | TCM-ID: TCMC754 |
| Smiles: O=C(Oc1ccc(cc1CC=C(C)C)/C=C/C(=O)O)CCc1ccccc1 | |
| Alias:
Benzenepropanoic acid, 4-(2-carboxyethenyl)-2-(3-methyl-2-butenyl)phenyl ester, (E)-;
Benzenepropanoic acid, 4-[(1E)-2-carboxyethenyl]-2-(3-methyl-2-butenyl)phenyl ester; (E)-3-Prenyl-4-(2,3-dihydrocinnamoyloxy)cinnamic acid; (E)-4-[(Dihydrocinnamoyl)oxy]-3-prenylcinnamic acid; Bacarina; Bacarine; Baccharin |
Structure:
|
Related Targets (Total: 3)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T78GRC | Aldo-keto reductase family 1 member C3 | AKR1C3 |
P42330 |
A | 1 Reference(s) |
| T26EZU | Myc proto-oncogene protein | MYC |
P01106 |
B | 1 Reference(s) |
| T87O4D | Mitogen-activated protein kinase 7 | MAPK7 |
Q13164 |
B | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H1183 | Hong Dou | 红豆 | Hosie ormosia | Ormosia hosiei |
Ckey description of the interaction between compound and target