Compound Description
| ID: C1109 | Common name: trypsin |
| IUPAC: acetic acid;tert-butyl N-[(2S)-1-[[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-[(5-methyl-2-oxochromen-7-yl)amino]-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate | CAS: CAS:9002-07-7 |
| Chembl ID: NA | Pubchem ID: CID:5311489 |
| Formula: C35H47N7O10 | TCM-ID: TCMC7545 |
| Smiles: CC1=CC(=CC2=C1C=CC(=O)O2)NC(=O)C(CCCN=C(N)N)NC(=O)C(CO)NC(=O)C(CC3=CC=CC=C3)NC(=O)OC(C)(C)C.CC(=O)O | |
| Alias:
Cocoonase;
E.C. 3.4.21.4; E.C. 3.4.4.4; PTN; PTN 3.0 Special; PTN 3.0S; PTN 6.0S; PYN 3.0S; Parenzyme; Parenzymol; Pseudotrypsin; Serine protease PRSS1; Sperm receptor hydrolase; TRYPLE; Tripcellim; Trypsin V; Tryptar; Tryptec Formula 4X; Tryptec Formula One; Trypure; Trypzean; Typtar |
Structure:
|
Related Targets (Total: 16)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T44LWL | Transcription factor p65 | RELA |
Q04206 |
A | 1 Reference(s) |
| T02WMA | Ornithine decarboxylase | ODC1 |
P11926 |
B | 1 Reference(s) |
| T88QQE | Fibroblast growth factor 2 | FGF2 |
P09038 |
B | 1 Reference(s) |
| T54CIF | Interleukin-8 | CXCL8 |
P10145 |
B | 1 Reference(s) |
| T30VNV | Myeloperoxidase | MPO |
P05164 |
B | 1 Reference(s) |
| T63GUB | Proto-oncogene c-Fos | FOS |
P01100 |
B | 1 Reference(s) |
| T19CUN | Prothrombin | F2 |
P00734 |
B | 1 Reference(s) |
| T80GUN | 72 kDa type IV collagenase | MMP2 |
P08253 |
B | 1 Reference(s) |
| T89GFN | Macrophage migration inhibitory factor | MIF |
P14174 |
B | 1 Reference(s) |
| T19EKF | Cholecystokinin | CCK |
P06307 |
B | 1 Reference(s) |
| T49TDM | Matrix metalloproteinase-9 | MMP9 |
P14780 |
B | 1 Reference(s) |
| T53AOE | Transforming growth factor beta-1 proprotein [Cleaved into: Latency-associated peptide | TGFB1 |
P01137 |
B | 1 Reference(s) |
| T68WYW | von Willebrand factor | VWF |
P04275 |
B | 1 Reference(s) |
| T21DZX | Amine oxidase [flavin-containing] A | MAOA |
P21397 |
B | 1 Reference(s) |
| T36SOV | Plasminogen activator inhibitor 1 | SERPINE1 |
P05121 |
C | 1 Reference(s) |
| T17CZC | Tissue factor | F3 |
P13726 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target