Compound Description
| ID: C1142 | Common name: oleandrin |
| IUPAC: [(3S,8R,9S,10S,13R,14S,16S,17R)-14-hydroxy-3-[(2R,4S,5S,6S)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-16-yl] acetate | CAS: CAS:465-16-7 |
| Chembl ID: NA | Pubchem ID: CID:6478017 |
| Formula: C32H48O9 | TCM-ID: TCMC7575 |
| Smiles: CC1C(C(CC(O1)OC2CCC3(C(C2)CCC4C3CCC5(C4(CC(C5C6=CC(=O)OC6)OC(=O)C)O)C)C)OC)O | |
| Alias:
Oleandrin (6CI,7CI,8CI);
Corrigen; Foliandrin; Folinerin; Neriol; Neriolin; Neriostene; Oleandrigenin 3-O-alpha-L-oleandroside; Oleandrine |
Structure:
|
Related Targets (Total: 6)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T74V1Z | Dual specificity mitogen-activated protein kinase kinase 7 | MAP2K7 |
O14733 |
B | 1 Reference(s) |
| T54CIF | Interleukin-8 | CXCL8 |
P10145 |
B | 1 Reference(s) |
| T71XEF | fMet-Leu-Phe receptor | FPR1 |
P21462 |
B | 1 Reference(s) |
| T83QHM | Beta-nerve growth factor | NGF |
P01138 |
B | 1 Reference(s) |
| T88QQE | Fibroblast growth factor 2 | FGF2 |
P09038 |
B | 1 Reference(s) |
| T26KIE | Transcription factor AP-1 | JUN |
P05412 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target