Compound Description
| ID: C1147 | Common name: yohimbine |
| IUPAC: NA | CAS: CAS:146-48-5 |
| Chembl ID: CHEMBL15245 | Pubchem ID: CID:8969 |
| Formula: C21H26N2O3 | TCM-ID: TCMC7580 |
| Smiles: COC(=O)C1C(CCC2C1CC3C4=C(CCN3C2)C5=CC=CC=C5N4)O | |
| Alias:
Yohimban-16alpha-carboxylic acid, 17alpha-hydroxy-, methyl ester (8CI);
Yohimbol-16alpha-carboxylic acid, methyl ester (6CI); Benz[g]indolo[2,3-a]quinolizine, yohimban-16-carboxylic acid deriv.; (+)-Yohimbine; Aphrodine; Aphrosol; Corynine; Quebrachin; Quebrachine; Yohimbic acid methyl ester; Yohimbin; Yohimbine; trans-Quinolizidine yohimbine |
Structure:
|
Related Targets (Total: 5)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T77RFX | Alpha-2A adrenergic receptor | ADRA2A |
P08913 |
A | 1 Reference(s) |
| T09H2Z | Nitric oxide synthase, inducible | NOS2 |
P35228 |
B | 1 Reference(s) |
| T02HVB | Midkine | MDK |
P21741 |
B | 1 Reference(s) |
| T99EYH | Lipoprotein lipase | LPL |
P06858 |
B | 1 Reference(s) |
| T83QHM | Beta-nerve growth factor | NGF |
P01138 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target