Compound Description
| ID: C1148 | Common name: anacardic acid |
| IUPAC: 2-hydroxy-6-[(8Z,11Z)-pentadeca-8,11,14-trienyl]benzoic acid | CAS: CAS:11034-77-8 |
| Chembl ID: CHEMBL455368 | Pubchem ID: CID:9875131 |
| Formula: C22H30O3 | TCM-ID: TCMC7581 |
| Smiles: C=CCC=CCC=CCCCCCCCC1=C(C(=CC=C1)O)C(=O)O | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 2)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T80DCQ | Aurora kinase A | AURKA |
O14965 |
A | 1 Reference(s) |
| T41SFE | Histone acetyltransferase p300 | EP300 |
Q09472 |
B | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target