Compound Description
| ID: C1149 | Common name: vincristine |
| IUPAC: NA | CAS: CAS:57-22-7 |
| Chembl ID: CHEMBL90555 | Pubchem ID: CID:5978 |
| Formula: C46H56N4O10 | TCM-ID: TCMC7582 |
| Smiles: CCC1(CC2CC(C3=C(CCN(C2)C1)C4=CC=CC=C4N3)(C5=C(C=C6C(=C5)C78CCN9C7C(C=CC9)(C(C(C8N6C=O)(C(=O)OC)O)OC(=O)C)CC)OC)C(=O)OC)O | |
| Alias:
Leurocristine (7CI,8CI);
1H-Indolizino[8,1-cd]carbazole, vincaleukoblastine deriv.; 2H-3,7-Methanoazacycloundecino[5,4-b]indole, vincaleukoblastine deriv.; (+)-Vincristine; 22-Oxovincaleukoblastine; LCR; Leucristine; OncoTCS; VCR; Vincristin; Vincristine; Vinkristin |
Structure:
|
Related Targets (Total: 17)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T30DE0 | Mitogen-activated protein kinase 13 | MAPK13 |
O15264 |
B | 1 Reference(s) |
| T64T4I | Telomerase protein component 1 | TEP1 |
Q99973 |
B | 1 Reference(s) |
| T25H22 | Protein kinase C beta type | PRKCB |
P05771 |
B | 1 Reference(s) |
| T29MD1 | Mitogen-activated protein kinase 8 | MAPK8 |
P45983 |
B | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
B | 1 Reference(s) |
| T74I49 | Bcl-2-like protein 1 | BCL2L1 |
Q07817 |
B | 1 Reference(s) |
| T64W2K | Cyclin-dependent kinase inhibitor 1 | CDKN1A |
P38936 |
B | 1 Reference(s) |
| T88AJI | Hypoxia-inducible factor 1-alpha | HIF1A |
Q16665 |
B | 1 Reference(s) |
| T23VMI | Tumor necrosis factor | TNF |
P01375 |
B | 1 Reference(s) |
| T40S5Y | Heat shock protein 75 kDa, mitochondrial | TRAP1 |
Q12931 |
B | 1 Reference(s) |
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
C | 1 Reference(s) |
| T70SFS | Superoxide dismutase [Mn], mitochondrial | SOD2 |
P04179 |
C | 1 Reference(s) |
| T26KIE | Transcription factor AP-1 | JUN |
P05412 |
C | 1 Reference(s) |
| T39WPZ | Mitogen-activated protein kinase 9 | MAPK9 |
P45984 |
C | 1 Reference(s) |
| T47WT6 | Breast cancer type 1 susceptibility protein | BRCA1 |
P38398 |
C | 1 Reference(s) |
| T74V1Z | Dual specificity mitogen-activated protein kinase kinase 7 | MAP2K7 |
O14733 |
C | 1 Reference(s) |
| T81KAJ | X-ray repair cross-complementing protein 6 | XRCC6 |
P12956 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target