Compound Description
| ID: C1159 | Common name: artemisinin |
| IUPAC: NA | CAS: CAS:63968-64-9 |
| Chembl ID: CHEMBL345083 | Pubchem ID: CID:2240 |
| Formula: C15H22O5 | TCM-ID: TCMC7592 |
| Smiles: CC1CCC2C(C(=O)OC3C24C1CCC(O3)(OO4)C)C | |
| Alias:
3,12-Epoxy-12H-pyrano[4,3-j]-1,2-benzodioxepin-10(3H)-one, octahydro-3,6,9-trimethyl-, [3R-(3alpha,5abeta,6beta,8abeta,9alpha,12beta,12aR*)]-;
(+)-Arteannuin; (+)-Artemisinin; (+)-Qinghaosu; Arteannuin; Artemef; Artemisine; Artemisinin; Artemisinine; Huanghuahaosu; NSC 369397; QHS; Qing Hau Sau; Qing Hau Su; Qinghaosu; Qinghosu |
Structure:
|
Related Targets (Total: 17)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T76EHP | Glutathione S-transferase A1 | GSTA1 |
P08263 |
A | 1 Reference(s) |
| T46AQJ | Glutathione S-transferase P | GSTP1 |
P09211 |
A | 1 Reference(s) |
| T06URY | Transcription factor Sp1 | SP1 |
P08047 |
A | 1 Reference(s) |
| T54H9V | Tyrosyl-DNA phosphodiesterase 1 | TDP1 |
Q9NUW8 |
A | 1 Reference(s) |
| T23VMI | Tumor necrosis factor | TNF |
P01375 |
A | 1 Reference(s) |
| T09H2Z | Nitric oxide synthase, inducible | NOS2 |
P35228 |
B | 1 Reference(s) |
| T44LWL | Transcription factor p65 | RELA |
Q04206 |
B | 1 Reference(s) |
| T93W1J | Vascular endothelial growth factor C | VEGFC |
P49767 |
B | 1 Reference(s) |
| T44KU9 | Cytochrome P450 2B6 | CYP2B6 |
P20813 |
B | 2 Reference(s) |
| T85AXP | Cytochrome P450 3A4 | CYP3A4 |
P08684 |
B | 1 Reference(s) |
| T50WOV | ATP-dependent translocase ABCB1 | ABCB1 |
P08183 |
B | 1 Reference(s) |
| T50SX0 | Nuclear receptor subfamily 1 group I member 2 | NR1I2 |
O75469 |
B | 1 Reference(s) |
| T41INV | Nuclear receptor subfamily 1 group I member 3 | NR1I3 |
Q14994 |
B | 1 Reference(s) |
| T88AJI | Hypoxia-inducible factor 1-alpha | HIF1A |
Q16665 |
B | 1 Reference(s) |
| T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
B | 1 Reference(s) |
| T70SFS | Superoxide dismutase [Mn], mitochondrial | SOD2 |
P04179 |
C | 1 Reference(s) |
| T10S5F | Cyclin-dependent kinase 4 | CDK4 |
P11802 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target