Compound Description
| ID: C1161 | Common name: silydianin |
| IUPAC: NA | CAS: CAS:29782-68-1 |
| Chembl ID: NA | Pubchem ID: CID:3033957 |
| Formula: C25H22O10 | TCM-ID: TCMC7594 |
| Smiles: COC1=C(C=CC(=C1)C2C3COC4(C3C(=CC2C4=O)C5C(C(=O)C6=C(C=C(C=C6O5)O)O)O)O)O | |
| Alias:
3,6-Methanobenzofuran-7(6H)-one, 4-(3,4-dihydro-3,5,7-trihydroxy-4-oxo-2H-1-benzopyran-2-yl)-2,3,3a,7a-tetrahydro-7a-hydroxy-8-(4-hydroxy-3-methoxyphenyl)-, [3R-[3alpha,3abeta,4(2R*,3R*),6alpha,7abeta,8R*]]-;
3,6-Methanobenzofuran-7(6alphaH)-one, 2,3alpha,3aalpha,7a-tetrahydro-7aalpha-hydroxy-8-(4-hydroxy-3-methoxyphenyl)-4-(3alpha,5,7-trihydroxy-4-oxo-2beta-chromanyl)-, (+)- (8CI); Silidianin; Silidianine; Silydianin |
Structure:
|
Related Targets (Total: 11)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T85U8U | Caspase-3 | CASP3 |
P42574 |
B | 1 Reference(s) |
| T10AWW | M-phase inducer phosphatase 2 | CDC25B |
P30305 |
C | 1 Reference(s) |
| T10S5F | Cyclin-dependent kinase 4 | CDK4 |
P11802 |
C | 1 Reference(s) |
| T14XGP | Protocadherin alpha-C2 | PCDHAC2 |
Q9Y5I4 |
C | 1 Reference(s) |
| T22IMH | Cyclin-dependent kinase 6 | CDK6 |
Q00534 |
C | 1 Reference(s) |
| T42K6K | M-phase inducer phosphatase 3 | CDC25C |
P30307 |
C | 1 Reference(s) |
| T64W2K | Cyclin-dependent kinase inhibitor 1 | CDKN1A |
P38936 |
C | 1 Reference(s) |
| T75H3W | Cyclin-dependent kinase 2 | CDK2 |
P24941 |
C | 1 Reference(s) |
| T86UXL | Cyclin-A2 | CCNA2 |
P20248 |
C | 1 Reference(s) |
| T93WZG | G1/S-specific cyclin-D1 | CCND1 |
P24385 |
C | 1 Reference(s) |
| T95QJ9 | G1/S-specific cyclin-D3 | CCND3 |
P30281 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target