Compound Description
| ID: C1269 | Common name: Cyclic Adenosine Monophosphate |
| IUPAC: (4aR,6R,7R,7aS)-6-(6-aminopurin-9-yl)-2-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol | CAS: NA |
| Chembl ID: CHEMBL316966 | Pubchem ID: CID:6076 |
| Formula: C10H12N5O6P | TCM-ID: TCMC967 |
| Smiles: O[C@@H]1[C@@H]2OP(=O)(O)OC[C@H]2O[C@H]1n1cnc2c1ncnc2N | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 6)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T20VPX | Cyclin-dependent-like kinase 5 | CDK5 |
Q00535 |
A | 1 Reference(s) |
| T83BVT | Mitochondrial 2-oxodicarboxylate carrier | SLC25A21 |
Q9BQT8 |
A | 1 Reference(s) |
| T16MRU | NACHT, LRR and PYD domains-containing protein 3 | NLRP3 |
Q96P20 |
B | 1 Reference(s) |
| T78PK3 | cAMP-dependent protein kinase catalytic subunit alpha | PRKACA |
P17612 |
C | 1 Reference(s) |
| T56FPY | CD81 antigen | CD81 |
P60033 |
C | 1 Reference(s) |
| T92AMR | Hepatocyte growth factor receptor | MET |
P08581 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 3)
Ckey description of the interaction between compound and target