Compound Description
| ID: C0003 | Common name: Deguelin |
| IUPAC: NA | CAS: NA |
| Chembl ID: CHEMBL393417 | Pubchem ID: CID:107935 |
| Formula: C23H22O6 | TCM-ID: TCMC1001 |
| Smiles: COc1cc2c(cc1OC)OC[C@@H]1[C@H]2C(=O)c2c(O1)c1C=CC(Oc1cc2)(C)C | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 13)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
A | 4 Reference(s) |
| T01E7W | Aurora kinase B | AURKB |
Q96GD4 |
A | 3 Reference(s) |
| T13YN2 | Bcl-2-like protein 1 | Bcl2l1 |
Q64373 |
B | 1 Reference(s) |
| T06RMZ | Nuclear factor NF-kappa-B p105 subunit | NFKB1 |
P19838 |
B | 1 Reference(s) |
| T96OOK | Signal transducer and activator of transcription 3 | STAT3 |
P40763 |
C | 1 Reference(s) |
| T92AMR | Hepatocyte growth factor receptor | MET |
P08581 |
C | 1 Reference(s) |
| T67HAF | Signal transducer and activator of transcription 1-alpha/beta | STAT1 |
P42224 |
C | 1 Reference(s) |
| T81I6O | Nucleophosmin | NPM1 |
P06748 |
C | 1 Reference(s) |
| T37PW4 | DNA replication licensing factor MCM3 | MCM3 |
P25205 |
C | 1 Reference(s) |
| T93OBS | Cell division control protein 45 homolog | CDC45 |
O75419 |
C | 1 Reference(s) |
| T82ALJ | Glycogen synthase kinase-3 beta | GSK3B |
P49841 |
C | 1 Reference(s) |
| T54FKY | Serine/threonine-protein kinase Nek2 | NEK2 |
P51955 |
C | 1 Reference(s) |
| T40JZG | GPI-anchor transamidase | PIGK |
Q92643 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target