Compound Description
| ID: C0222 | Common name: Metoprolol |
| IUPAC: 1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol | CAS: CAS:51384-51-1 |
| Chembl ID: CHEMBL13 | Pubchem ID: CID:4171 |
| Formula: C15H25NO3 | TCM-ID: TCMC1585 |
| Smiles: COCCc1ccc(cc1)OCC(CNC(C)C)O | |
| Alias:
1-[4-(2-Methoxyethyl)phenoxy]-3-[(1-methylethyl)amino]-2-propanol;
(RS)-Metoprolol; (±)-Metoprolol; 1-Isopropylamino-3-[4-(2-methoxyethyl)phenoxy]-2-propanol; 1-[4-(2-Methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol; Beatrolol; CGP 2175; Meijoprolol; Metocard; Metoprolol; Seroken; Spesicor; Toprol; Vazocardin; [2-Hydroxy-3-[4-(2-methoxyethyl)phenoxy]propyl](propan-2-yl)amine; dl-Metoprolol |
Structure:
|
Related Targets (Total: 6)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T64T6J | Beta-1 adrenergic receptor | ADRB1 |
P08588 |
A | 9 Reference(s) |
| T36O3K | Beta-adrenergic receptor kinase 1 | GRK2 |
P25098 |
A | 1 Reference(s) |
| T63GUB | Proto-oncogene c-Fos | FOS |
P01100 |
A | 1 Reference(s) |
| T76B0A | Gap junction alpha-1 protein | GJA1 |
P17302 |
A | 1 Reference(s) |
| T11ZYR | Cytochrome P450 2D6 | CYP2D6 |
P10635 |
B | 1 Reference(s) |
| T78QVQ | Myosin-7 | MYH7 |
P12883 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target