Compound Description
| ID: C0280 | Common name: Oxytocin |
| IUPAC: (2S)-1-[(4R,7S,10S,13S,16S,19R)-19-amino-7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-13-[(2S)-butan-2-yl]-16-[(4-hydroxyphenyl)methyl]-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentazacycloicosane-4-carbonyl]-N-[(2S)-1-[(2-amino-2-oxoethyl)amino]-4-methyl-1-oxopentan-2-yl]pyrrolidine-2-carboxamide | CAS: NA |
| Chembl ID: CHEMBL395429 | Pubchem ID: CID:439302 |
| Formula: C43H66N12O12S2 | TCM-ID: TCMC1822 |
| Smiles: CC[C@@H]([C@@H]1N=C(O)[C@H](Cc2ccc(cc2)O)N=C(O)[C@@H](N)CSSC[C@H](N=C([C@@H](N=C([C@@H](N=C1O)CCC(=N)O)O)CC(=N)O)O)C(=O)N1CCC[C@H]1C(=N[C@H](C(=NCC(=N)O)O)CC(C)C)O)C | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 13)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T84FRS | Oxytocin-neurophysin 1 | OXT |
P01178 |
A | 1 Reference(s) |
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
A | 1 Reference(s) |
| T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
A | 1 Reference(s) |
| T76GZS | Oxytocin receptor | OXTR |
P30559 |
B | 1 Reference(s) |
| T38J3Y | Gamma-enolase | ENO2 |
P09104 |
C | 1 Reference(s) |
| T68BGR | Glial fibrillary acidic protein | GFAP |
P14136 |
C | 1 Reference(s) |
| T68PGG | Solute carrier family 12 member 5 | SLC12A5 |
Q9H2X9 |
C | 1 Reference(s) |
| T06MQM | Heat shock protein beta-1 | HSPB1 |
P04792 |
C | 1 Reference(s) |
| T14ENF | Microtubule-associated protein 2 | MAP2 |
P11137 |
C | 1 Reference(s) |
| T46YMA | Ras-related C3 botulinum toxin substrate 1 | RAC1 |
P63000 |
C | 1 Reference(s) |
| T74J8E | Synaptic vesicular amine transporter | SLC18A2 |
Q05940 |
C | 1 Reference(s) |
| T00YTT | 2',3'-cyclic-nucleotide 3'-phosphodiesterase | CNP |
P09543 |
C | 1 Reference(s) |
| T98DNG | Natriuretic peptides A | NPPA |
P01160 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target