Compound Description
| ID: C0316 | Common name: Piplartine |
| IUPAC: 1-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]-2,3-dihydropyridin-6-one | CAS: CAS:20069-09-4 |
| Chembl ID: CHEMBL465843 | Pubchem ID: CID:637858 |
| Formula: C17H19NO5 | TCM-ID: TCMC1909 |
| Smiles: COC1=CC(=CC(=C1OC)OC)C=CC(=O)N2CCC=CC2=O | |
| Alias:
2(1H)-Pyridinone, 5,6-dihydro-1-[(2E)-1-oxo-3-(3,4,5-trimethoxyphenyl)-2-propenyl]-;
2(1H)-Pyridinone, 5,6-dihydro-1-[1-oxo-3-(3,4,5-trimethoxyphenyl)-2-propenyl]-, (E)-; 2(1H)-Pyridone, 5,6-dihydro-1-(3,4,5-trimethoxycinnamoyl)-; 5,6-Dihydro-1-[(2E)-1-oxo-3-(3,4,5-trimethoxyphenyl)-2-propen-1-yl]-2(1H)-pyridinone; Piperlongumine; Piplartin; Piplartine |
Structure:
|
Related Targets (Total: 6)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T68NCI | Aldo-keto reductase family 1 member B1 | AKR1B1 |
P15121 |
A | 1 Reference(s) |
| T47H3O | Heat shock protein HSP 90-alpha | HSP90AA1 |
P07900 |
A | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
A | 1 Reference(s) |
| T77W6N | Thioredoxin reductase 1, cytoplasmic | TXNRD1 |
Q16881 |
A | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
B | 1 Reference(s) |
| T54KVP | Protein regulator of cytokinesis 1 | PRC1 |
O43663 |
B | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 5)
Ckey description of the interaction between compound and target