Compound Description
| ID: C0365 | Common name: Retinal |
| IUPAC: (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenal | CAS: NA |
| Chembl ID: CHEMBL81379 | Pubchem ID: CID:638015 |
| Formula: C20H28O | TCM-ID: TCMC2005 |
| Smiles: CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC=O)C)C | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 14)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T74V1Z | Dual specificity mitogen-activated protein kinase kinase 7 | MAP2K7 |
O14733 |
A | 2 Reference(s) |
| T32REB | Calcium/calmodulin-dependent protein kinase type II subunit gamma | CAMK2G |
Q13555 |
B | 1 Reference(s) |
| T13LKL | Rhodopsin | RHO |
P08100 |
B | 1 Reference(s) |
| T04GJ1 | Opsin-3 | OPN3 |
Q9H1Y3 |
B | 1 Reference(s) |
| T32OC4 | Aldehyde dehydrogenase, mitochondrial | ALDH2 |
P05091 |
B | 1 Reference(s) |
| T58JEK | Melanopsin | OPN4 |
Q9UHM6 |
B | 1 Reference(s) |
| T36TO2 | Endoglin | ENG |
P17813 |
B | 1 Reference(s) |
| T44K9U | NA | MIR155 |
NA |
C | 1 Reference(s) |
| T54SZZ | Endoplasmic reticulum chaperone BiP | HSPA5 |
P11021 |
C | 1 Reference(s) |
| T01SRY | PR domain zinc finger protein 13 | PRDM13 |
Q9H4Q3 |
C | 1 Reference(s) |
| T03U05 | Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-3 | GNB3 |
P16520 |
C | 1 Reference(s) |
| T10FOS | Neurotrophin-3 | NTF3 |
P20783 |
C | 1 Reference(s) |
| T13YN2 | Bcl-2-like protein 1 | Bcl2l1 |
Q64373 |
C | 1 Reference(s) |
| T23P74 | Caspase-9 | CASP9 |
P55211 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 5)
Ckey description of the interaction between compound and target