Compound Description
| ID: C0652 | Common name: Uralsaponin A |
| IUPAC: (2S,3S,4S,5R,6R)-6-[(2R,3R,4S,5S,6S)-2-[[(3S,4aR,6aR,6bS,8aS,11S,12aR,14aR,14bS)-11-carboxy-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-2,3,4a,5,6,7,8,9,10,12,12a,14a-dodecahydro-1H-picen-3-yl]oxy]-6-carboxy-4,5-dihydroxyoxan-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid | CAS: CAS:103000-77-7 |
| Chembl ID: NA | Pubchem ID: CID:128229 |
| Formula: C42H62O16 | TCM-ID: TCMC3475 |
| Smiles: O[C@@H]1[C@@H](O[C@@H]2O[C@H](C(=O)[O-])[C@H]([C@@H]([C@H]2O)O)O)[C@@H](O[C@@H]([C@H]1O)C(=O)[O-])O[C@H]1CC[C@]2([C@H](C1(C)C)CC[C@@]1([C@@H]2C(=O)C=C2[C@@]1(C)CC[C@@]1([C@H]2C[C@](C)(CC1)C(=O)[O-])C)C)C | |
| Alias:
(3β,20β)-20-Carboxy-11-oxo-30-norolean-12-en-3-yl 2-O-β-D-glucopyranuronosyl-β-D-glucopyranosiduronic acid;
Glycyrrhezinic acid; Glycyrrhizin; Glycyrrhizinic acid; Uralsaponin A |
Structure:
|
Related Targets (Total: 8)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T92HNO | High mobility group protein B1 | HMGB1 |
P09429 |
A | 33 Reference(s) |
| T50SX0 | Nuclear receptor subfamily 1 group I member 2 | NR1I2 |
O75469 |
A | 1 Reference(s) |
| T94K7H | Cytochrome P450 7A1 | CYP7A1 |
P22680 |
A | 1 Reference(s) |
| T83YZD | Acetylcholinesterase | ACHE |
P22303 |
A | 1 Reference(s) |
| T22OPB | Nuclear factor erythroid 2-related factor 2 | NFE2L2 |
Q16236 |
A | 1 Reference(s) |
| T88B8X | Insulin receptor | INSR |
P06213 |
C | 1 Reference(s) |
| T91OUC | Mucin-5AC | MUC5AC |
P98088 |
C | 1 Reference(s) |
| T27BN7 | Protachykinin-1 | TAC1 |
P20366 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H1066 | Gan Cao | 甘草 | Glycyrrhiza inflata | Glycyrrhiza uralensis |
Ckey description of the interaction between compound and target