Compound Description
| ID: C0660 | Common name: Neferine |
| IUPAC: 4-[[(1R)-6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]-2-[[(1R)-6-methoxy-1-[(4-methoxyphenyl)methyl]-2-methyl-3,4-dihydro-1H-isoquinolin-7-yl]oxy]phenol | CAS: CAS:2292-16-2 |
| Chembl ID: CHEMBL455560 | Pubchem ID: CID:159654 |
| Formula: C38H44N2O6 | TCM-ID: TCMC3564 |
| Smiles: COc1ccc(cc1)C[C@H]1[NH+](C)CCc2c1cc(Oc1cc(ccc1O)C[C@H]1[NH+](C)CCc3c1cc(OC)c(c3)OC)c(c2)OC | |
| Alias:
Neferine;
4-[[(1S)-1,2,3,4-Tetrahydro-6,7-dimethoxy-2-methyl-1-isoquinolinyl]methyl]-2-[[(1R)-1,2,3,4-tetrahydro-6-methoxy-1-[(4-methoxyphenyl)methyl]-2-methyl-7-isoquinolinyl]oxy]phenol; (-)-Neferine; 4''-O-Methylliensinine; Methylliensinine; Neferin |
Structure:
|
Related Targets (Total: 7)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T98RXH | Focal adhesion kinase 1 | PTK2 |
Q05397 |
A | 1 Reference(s) |
| T40NB1 | Ribosomal protein S6 kinase beta-1 | RPS6KB1 |
P23443 |
A | 1 Reference(s) |
| T94S85 | Collagen alpha-1(I) chain | COL1A1 |
P02452 |
A | 1 Reference(s) |
| T18SKL | C-C motif chemokine 5 | CCL5 |
P13501 |
C | 1 Reference(s) |
| T31P1D | Metalloproteinase inhibitor 1 | TIMP1 |
P01033 |
C | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 1 Reference(s) |
| T32ECR | Collagen alpha-2(I) chain | COL1A2 |
P08123 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0141 | Lian Zi Xin | 莲子心 | Hindu lotus plumule | Nelumbo nucifera |
Ckey description of the interaction between compound and target