Compound Description
| ID: C0753 | Common name: Mangiferin |
| IUPAC: 1,3,6,7-tetrahydroxy-2-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]xanthen-9-one | CAS: CAS:4773-96-0 |
| Chembl ID: CHEMBL464825 | Pubchem ID: CID:5281647 |
| Formula: C19H18O11 | TCM-ID: TCMC4351 |
| Smiles: C1=C2C(=CC(=C1O)O)OC3=C(C2=O)C(=C(C(=C3)O)C4C(C(C(C(O4)CO)O)O)O)O | |
| Alias:
Mangiferin;
2-β-D-Glucopyranosyl-1,3,6,7-tetrahydroxy-9H-xanthen-9-one; 1,3,6,7-Tetrahydroxyxanthone-C2-β-D-glucoside; 2-C-β-D-Glucopyranosyl-1,3,6,7-tetrahydroxyxanthone; Alpizarin; Alpizarine; Aphloiol; Chinomin; Chinonin; Hedysarid; NSC 248870; Shamimin |
Structure:
|
Related Targets (Total: 15)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T22OPB | Nuclear factor erythroid 2-related factor 2 | NFE2L2 |
Q16236 |
A | 1 Reference(s) |
| T16UZ4 | Dipeptidyl peptidase 4 | DPP4 |
P27487 |
A | 1 Reference(s) |
| T06RMZ | Nuclear factor NF-kappa-B p105 subunit | NFKB1 |
P19838 |
A | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
A | 1 Reference(s) |
| T11BI7 | Toll-like receptor 4 | TLR4 |
O00206 |
A | 1 Reference(s) |
| T49ORJ | Peroxisome proliferator-activated receptor alpha | PPARA |
Q07869 |
B | 1 Reference(s) |
| T44LWL | Transcription factor p65 | RELA |
Q04206 |
B | 1 Reference(s) |
| T27F5B | Interleukin-1 receptor-associated kinase 1 | IRAK1 |
P51617 |
B | 1 Reference(s) |
| T16A2X | Catalase | CAT |
P04040 |
C | 1 Reference(s) |
| T30D9G | Superoxide dismutase [Cu-Zn] | SOD1 |
P00441 |
C | 1 Reference(s) |
| T90XYZ | C-reactive protein | CRP |
P02741 |
C | 1 Reference(s) |
| T64BTV | Interleukin-1 beta | IL1B |
P01584 |
C | 1 Reference(s) |
| T20W8R | NA | MIR182 |
NA |
C | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 1 Reference(s) |
| T13YN2 | Bcl-2-like protein 1 | Bcl2l1 |
Q64373 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 3)
Ckey description of the interaction between compound and target