Compound Description
| ID: C0759 | Common name: Tectorigenin |
| IUPAC: 5,7-dihydroxy-3-(4-hydroxyphenyl)-6-methoxychromen-4-one | CAS: CAS:548-77-6 |
| Chembl ID: CHEMBL242740 | Pubchem ID: CID:5281811 |
| Formula: C16H12O6 | TCM-ID: TCMC4374 |
| Smiles: COC1=C(C2=C(C=C1O)OC=C(C2=O)C3=CC=C(C=C3)O)O | |
| Alias:
Isoflavone, 4',5,7-trihydroxy-6-methoxy-;
Tectorigenin; 5,7-Dihydroxy-3-(4-hydroxyphenyl)-6-methoxy-4H-1-benzopyran-4-one; 5,7,4'-Trihydroxy-6-methoxyisoflavone; K 251T; Tectrigenin |
Structure:
|
Related Targets (Total: 13)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T58J2Y | Peroxisome proliferator-activated receptor gamma | PPARG |
P37231 |
A | 1 Reference(s) |
| T09H2Z | Nitric oxide synthase, inducible | NOS2 |
P35228 |
B | 1 Reference(s) |
| T64BTV | Interleukin-1 beta | IL1B |
P01584 |
B | 1 Reference(s) |
| T16OQ5 | Puromycin-sensitive aminopeptidase | NPEPPS |
P55786 |
B | 1 Reference(s) |
| T84PM0 | Prostaglandin E2 receptor EP3 subtype | PTGER3 |
P43115 |
C | 1 Reference(s) |
| T68NCI | Aldo-keto reductase family 1 member B1 | AKR1B1 |
P15121 |
C | 1 Reference(s) |
| T78IOY | Telomerase reverse transcriptase | TERT |
O14746 |
C | 1 Reference(s) |
| T85HMF | Metalloproteinase inhibitor 3 | TIMP3 |
P35625 |
C | 1 Reference(s) |
| T13LU4 | SAM pointed domain-containing Ets transcription factor | SPDEF |
O95238 |
C | 1 Reference(s) |
| T42XY2 | Insulin-like growth factor 1 receptor | IGF1R |
P08069 |
C | 1 Reference(s) |
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
C | 1 Reference(s) |
| T71ZSO | High affinity immunoglobulin epsilon receptor subunit alpha | FCER1A |
P12319 |
C | 1 Reference(s) |
| T28K6X | Insulin receptor substrate 1 | IRS1 |
P35568 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0432 | She Gan | 射干 | Blackberrylily | Belamcanda chinensis |
Ckey description of the interaction between compound and target