Compound Description
| ID: C0773 | Common name: Morin |
| IUPAC: 5-(5,6-dimethoxy-1-benzofuran-2-yl)benzene-1,3-diol | CAS: NA |
| Chembl ID: CHEMBL3397393 | Pubchem ID: CID:5319889 |
| Formula: C16H14O5 | TCM-ID: TCMC4785 |
| Smiles: COc1cc2oc(cc2cc1OC)c1cc(O)cc(c1)O | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 14)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T16A2X | Catalase | CAT |
P04040 |
A | 1 Reference(s) |
| T30VNV | Myeloperoxidase | MPO |
P05164 |
A | 1 Reference(s) |
| T57L0X | Oxysterols receptor LXR-alpha | NR1H3 |
Q13133 |
A | 2 Reference(s) |
| T58J2Y | Peroxisome proliferator-activated receptor gamma | PPARG |
P37231 |
A | 1 Reference(s) |
| T82ALJ | Glycogen synthase kinase-3 beta | GSK3B |
P49841 |
A | 2 Reference(s) |
| T20RA0 | Adenosine deaminase | ADA |
P00813 |
A | 1 Reference(s) |
| T10WAM | Death-associated protein kinase 1 | DAPK1 |
P53355 |
A | 1 Reference(s) |
| T34Y8V | Oxysterols receptor LXR-beta | NR1H2 |
P55055 |
A | 2 Reference(s) |
| T29M6N | Cyclin-G2 | CCNG2 |
Q16589 |
B | 1 Reference(s) |
| T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
B | 1 Reference(s) |
| T47F9W | Galectin-3 | LGALS3 |
P17931 |
C | 1 Reference(s) |
| T82JWE | Cellular tumor antigen p53 | TP53 |
P04637 |
C | 1 Reference(s) |
| T60I6V | E3 SUMO-protein ligase PIAS3 | PIAS3 |
Q9Y6X2 |
C | 1 Reference(s) |
| T63PKK | NA | MIR29A |
NA |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0396 | Sang Ye | 桑叶 | White mulberry leaf | Morus alba |
Ckey description of the interaction between compound and target