Compound Description
| ID: C0787 | Common name: Anacardic Acid |
| IUPAC: 2-hydroxy-6-[(8E,11E)-pentadeca-8,11,14-trienyl]benzoic acid | CAS: NA |
| Chembl ID: CHEMBL464925 | Pubchem ID: CID:5388781 |
| Formula: C22H30O3 | TCM-ID: TCMC4975 |
| Smiles: C=CC/C=C/C/C=C/CCCCCCCc1cccc(c1C(=O)[O-])O | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 7)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T41SFE | Histone acetyltransferase p300 | EP300 |
Q09472 |
A | 2 Reference(s) |
| T15M1G | CREB-binding protein | CREBBP |
Q92793 |
A | 1 Reference(s) |
| T20TPU | Histone acetyltransferase KAT2B | KAT2B |
Q92831 |
A | 1 Reference(s) |
| T47H3O | Heat shock protein HSP 90-alpha | HSP90AA1 |
P07900 |
A | 1 Reference(s) |
| T80DCQ | Aurora kinase A | AURKA |
O14965 |
A | 1 Reference(s) |
| T67ZT3 | Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN | PTEN |
P60484 |
B | 1 Reference(s) |
| T32ECR | Collagen alpha-2(I) chain | COL1A2 |
P08123 |
C | 2 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H1051 | Bai Guo | 白果 | Ginkgo nut | Ginkgo biloba |
Ckey description of the interaction between compound and target