Compound Description
| ID: C0886 | Common name: Dioscin |
| IUPAC: (3R,4R,5R,6S)-2-[(2R,3S,4S,5R,6R)-4-hydroxy-2-(hydroxymethyl)-6-[(1S,2R,4S,5'R,6R,7S,8R,9S,12S,13R,16S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl]oxy-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol | CAS: CAS:19057-60-4 |
| Chembl ID: NA | Pubchem ID: CID:45358125 |
| Formula: C45H72O16 | TCM-ID: TCMC6740 |
| Smiles: OC[C@H]1O[C@@H](O[C@H]2CC[C@]3(C(=CC[C@@H]4[C@@H]3CC[C@]3([C@@H]4C[C@H]4[C@@H]3[C@H](C)[C@]3(O4)CC[C@H](CO3)C)C)C2)C)[C@@H]([C@H]([C@@H]1OC1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O | |
| Alias:
Dioscin;
(3β,25R)-Spirost-5-en-3-yl O-6-deoxy-α-L-mannopyranosyl-(1→2)-O-[6-deoxy-α-L-mannopyranosyl-(1→4)]-β-D-glucopyranoside; (+)-Dioscin; 3-O-β-D-α-L-Rhamnopyranosyl(1→4)-[α-L-rhamnopyranosyl(1→2)]-β-D-glucopyranoside-diosgenin; Collettiside III; Dioscine; Diosgenin 3-O-α-L-rhamnopyranosyl-(1→2)-[α-L-rhamnopyranosyl-(1→4)]-β-D-glucopyranoside; Diosgenin 3-O-α-L-rhamnopyranosyl-(1→4)-[α-L-rhamnopyranosyl-(1→2)]-β-D-glucopyranoside; Diosgenin bis-α-L-rhamnopyranosyl-(1→2 and 1→4)-β-D-glucopyranoside; Paris III; Parissaponin III; Polyphyllin III |
Structure:
|
Related Targets (Total: 8)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T24C0P | Bile acid receptor | NR1H4 |
Q96RI1 |
A | 1 Reference(s) |
| T84W8G | Aryl hydrocarbon receptor | AHR |
P35869 |
A | 1 Reference(s) |
| T34X07 | CCAAT/enhancer-binding protein alpha | CEBPA |
P49715 |
C | 1 Reference(s) |
| T51RTI | NA | HOTAIR |
NA |
C | 1 Reference(s) |
| T08KXM | Low-density lipoprotein receptor-related protein 5 | LRP5 |
O75197 |
C | 1 Reference(s) |
| T05AAL | Microphthalmia-associated transcription factor | MITF |
O75030 |
C | 1 Reference(s) |
| T72KIO | Peroxiredoxin-1 | PRDX1 |
Q06830 |
C | 1 Reference(s) |
| T96OOK | Signal transducer and activator of transcription 3 | STAT3 |
P40763 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0882 | Chuan Shan Long | 穿山龙 | Ningpo yam rhizome | Rhizoma dioscoreae nipponicae |
Ckey description of the interaction between compound and target