Compound Description
| ID: C0929 | Common name: Oxymatrine |
| IUPAC: (1R,2R,9S,13S,17S)-13-oxido-7-aza-13-azoniatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one | CAS: NA |
| Chembl ID: NA | Pubchem ID: CID:124708617 |
| Formula: C15H24N2O2 | TCM-ID: TCMC7337 |
| Smiles: O=C1CCC[C@H]2N1C[C@@H]1CCC[N@+]3([C@@H]1[C@@H]2CCC3)[O-] | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 9)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T39M81 | DNA-(apurinic or apyrimidinic site) endonuclease | APEX1 |
P27695 |
A | 1 Reference(s) |
| T12EWD | Cytochrome b-c1 complex subunit 7 | UQCRB |
P14927 |
B | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 1 Reference(s) |
| T67ZT3 | Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN | PTEN |
P60484 |
C | 1 Reference(s) |
| T43N2D | Epidermal growth factor receptor | EGFR |
P00533 |
C | 2 Reference(s) |
| T88IXL | Histone H2AX | H2AX |
P16104 |
C | 1 Reference(s) |
| T73LPO | Poly [ADP-ribose] polymerase 1 | PARP1 |
P09874 |
C | 1 Reference(s) |
| T67CB6 | Transcriptional regulator ERG | ERG |
P11308 |
C | 1 Reference(s) |
| T09KPZ | Vimentin | VIM |
P08670 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target