Compound Description
| ID: C1020 | Common name: danshensu |
| IUPAC: 2-(3,4-dihydroxyphenyl)-2-hydroxypropanoic acid;3-(3,4-dihydroxyphenyl)-2-hydroxypropanoic acid | CAS: CAS:76822-21-4 |
| Chembl ID: NA | Pubchem ID: CID:152463 |
| Formula: C9H10O5 | TCM-ID: TCMC7460 |
| Smiles: CC(C1=CC(=C(C=C1)O)O)(C(=O)O)O | |
| Alias:
SALVIANIC ACID A;
SALVIANIC ACID A SODIUM SALT; (r)-a,3,4-trihydroxybenzenepropanoic acid; 3-(3',4'-Dihydroxyphenyl)-(2R)-lactic acid; Danshensu; dan shen suan a; (R)-2-Hydroxy-3-(3,4-dihydroxyphenyl)propanoic acid; (R)-2-Hydroxy-3-(3,4-dihydroxyphenyl)propionic acid |
Structure:
|
Related Targets (Total: 8)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T44LWL | Transcription factor p65 | RELA |
Q04206 |
A | 1 Reference(s) |
| T30D9G | Superoxide dismutase [Cu-Zn] | SOD1 |
P00441 |
B | 1 Reference(s) |
| T03ON1 | Neurofibromin | NF1 |
P21359 |
B | 1 Reference(s) |
| T98DNG | Natriuretic peptides A | NPPA |
P01160 |
C | 1 Reference(s) |
| T31P1D | Metalloproteinase inhibitor 1 | TIMP1 |
P01033 |
C | 1 Reference(s) |
| T53AOE | Transforming growth factor beta-1 proprotein [Cleaved into: Latency-associated peptide | TGFB1 |
P01137 |
C | 1 Reference(s) |
| T78KL2 | Collagen alpha-1(III) chain | COL3A1 |
P02461 |
C | 1 Reference(s) |
| T94S85 | Collagen alpha-1(I) chain | COL1A1 |
P02452 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target