| ID: C1196 | Common name: Bradykinin |
| IUPAC: (2S)-2-[[(2S)-2-[[(2S)-1-[(2S)-2-[[(2S)-2-[[2-[[(2S)-1-[(2S)-1-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]-3-hydroxypropanoyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid | CAS: NA |
| Chembl ID: CHEMBL406291 | Pubchem ID: CID:439201 |
| Formula: C50H73N15O11 | TCM-ID: TCMC826 |
| Smiles: OC[C@@H](C(=O)N1CCC[C@H]1C(=N[C@H](C(=N[C@H](C(=O)O)CCCNC(=N)N)O)Cc1ccccc1)O)N=C([C@@H](N=C(CN=C([C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)N)O)O)Cc1ccccc1)O | |
| Alias:
NA
|
Structure:
|
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T48J2C | Transient receptor potential cation channel subfamily M member 7 | TRPM7 |
Q96QT4 |
A | 1 Reference(s) |
| T96OOK | Signal transducer and activator of transcription 3 | STAT3 |
P40763 |
A | 1 Reference(s) |
| T85J2J | B2 bradykinin receptor | BDKRB2 |
P30411 |
A | 3 Reference(s) |
| T10ICM | Oxidized low-density lipoprotein receptor 1 | OLR1 |
P78380 |
A | 1 Reference(s) |
| T46Y1L | Carboxypeptidase M | CPM |
P14384 |
B | 1 Reference(s) |
| T21O8C | Coagulation factor XII | F12 |
P00748 |
B | 1 Reference(s) |
| T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
C | 1 Reference(s) |
| T29C64 | Calcitonin gene-related peptide 1 | CALCA |
P06881;P01258 |
C | 1 Reference(s) |