Compound Description
| ID: C1197 | Common name: Brucine |
| IUPAC: (4aR,5aS,8aR,13aS,15aS,15bR)-10,11-dimethoxy-4a,5,5a,7,8,13a,15,15a,15b,16-decahydro-2H-4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinoline-14-one | CAS: CAS:357-57-3 |
| Chembl ID: CHEMBL501756 | Pubchem ID: CID:442021 |
| Formula: C23H26N2O4 | TCM-ID: TCMC830 |
| Smiles: COC1=C(C=C2C(=C1)C34CCN5C3CC6C7C4N2C(=O)CC7OCC=C6C5)OC | |
| Alias:
Brucine;
2,3-Dimethoxystrychnidin-10-one; 4,6-Methano-6H,14H-indolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinoline, strychnidin-10-one deriv.; (-)-Brucine; 2,3-Dimethoxystrychnine; l-Brucine |
Structure:
|
Related Targets (Total: 9)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T79KQO | NF-kappa-B inhibitor alpha | NFKBIA |
P25963 |
A | 1 Reference(s) |
| T44LWL | Transcription factor p65 | RELA |
Q04206 |
A | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
B | 1 Reference(s) |
| T50WOV | ATP-dependent translocase ABCB1 | ABCB1 |
P08183 |
B | 1 Reference(s) |
| T18CWB | Transcriptional activator Myb | MYB |
P10242 |
B | 1 Reference(s) |
| T52T5O | Axin-1 | AXIN1 |
O15169 |
C | 1 Reference(s) |
| T06YQX | Frizzled-8 | FZD8 |
Q9H461 |
C | 1 Reference(s) |
| T81R79 | Protein Wnt-5a | WNT5A |
P41221 |
C | 1 Reference(s) |
| T06IYF | Adenomatous polyposis coli protein | APC |
P25054 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0695 | Ya Dan Zi | 鸦胆子 | Java brucea | Brucea javanica |
Ckey description of the interaction between compound and target