Compound Description
| ID: C0282 | Common name: Paeoniflorin |
| IUPAC: NA | CAS: CAS:23180-57-6 |
| Chembl ID: CHEMBL1078549 | Pubchem ID: CID:46882877 |
| Formula: C23H28O11 | TCM-ID: TCMC1825 |
| Smiles: OC[C@H]1O[C@@H](O[C@]23C[C@H]4[C@@]3(COC(=O)c3ccccc3)[C@@H]3O[C@@]2(C)C[C@]4(O3)O)[C@@H]([C@H]([C@@H]1O)O)O | |
| Alias:
Peoniflorin;
β-D-Glucopyranoside, 5b-[(benzoyloxy)methyl]tetrahydro-5-hydroxy-2-methyl-2,5-methano-1H-3,4-dioxacyclobuta[cd]pentalen-1a(2H)-yl, [1aR-(1aα,2β,3aα,5α,5aα,5bα)]-; (1aR,2S,3aR,5R,5aR,5bS)-5b-[(Benzoyloxy)methyl]tetrahydro-5-hydroxy-2-methyl-2,5-methano-1H-3,4-dioxacyclobuta[cd]pentalen-1a(2H)-yl β-D-glucopyranoside; 2,5-Methano-1H-3,4-dioxacyclobuta[cd]pentalene, β-D-glucopyranoside deriv.; NSC 178886; Paeoniflorin |
Structure:
|
Related Targets (Total: 12)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
A | 1 Reference(s) |
| T34N64 | NA | MIR29B1 |
NA |
A | 1 Reference(s) |
| T01E8J | Amyloid-beta precursor protein | APP |
P05067 |
A | 1 Reference(s) |
| T22NX4 | Toll-like receptor 2 | TLR2 |
O60603 |
A | 1 Reference(s) |
| T52ARL | Suppressor of cytokine signaling 3 | SOCS3 |
O14543 |
A | 1 Reference(s) |
| T49TDM | Matrix metalloproteinase-9 | MMP9 |
P14780 |
A | 1 Reference(s) |
| T80R6A | Insulin-like growth factor I | IGF1 |
P05019 |
B | 1 Reference(s) |
| T18YXD | Albumin | ALB |
P02768 |
B | 1 Reference(s) |
| T23VMI | Tumor necrosis factor | TNF |
P01375 |
B | 1 Reference(s) |
| T88AJI | Hypoxia-inducible factor 1-alpha | HIF1A |
Q16665 |
C | 1 Reference(s) |
| T58CAO | Alpha-synuclein | SNCA |
P37840 |
C | 1 Reference(s) |
| T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 4)
Ckey description of the interaction between compound and target