Compound Description
| ID: C0415 | Common name: Stanolone |
| IUPAC: (5S,8R,9S,10S,13S,14S,17S)-17-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one | CAS: CAS:521-18-6 |
| Chembl ID: CHEMBL27769 | Pubchem ID: CID:10635 |
| Formula: C19H30O2 | TCM-ID: TCMC2104 |
| Smiles: O=C1CC[C@]2([C@H](C1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C)C | |
| Alias:
5α-Androstan-3-one, 17β-hydroxy-;
(5α,17β)-17-Hydroxyandrostan-3-one; (+)-Androstan-17β-ol-3-one; 17β-Hydroxy-3-androstanone; 17β-Hydroxy-5α-androstan-3-one; 17β-Hydroxy-5α-androstane-3-one; 4,5α-Dihydrotestosterone; 4-Dihydrotestosterone; 5-DHT; 5α,17β-Hydroxyandrostan-3-one; 5α-Androstan-17β-ol-3-one; 5α-Androstanolone; 5α-Dihydrotestosterone; Anaboleen; Anabolex; Andractim; Androlone; Androstan-17β-ol-3-one; Androstanolone; Cristerona MB; DHT; Dihydrotestosterone; LG 152; NSC 10972; Neodrol; Stanaprol; Stanolone; Testosterone, dihydro- |
Structure:
|
Related Targets (Total: 18)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T30V3R | 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase type 1 | HSD3B1 |
P14060 |
A | 1 Reference(s) |
| T20JZ2 | Androgen receptor | AR |
P10275 |
A | 13 Reference(s) |
| T41XLQ | E3 SUMO-protein ligase EGR2 | EGR2 |
P11161 |
A | 1 Reference(s) |
| T74QXI | Serine/threonine-protein kinase mTOR | MTOR |
P42345 |
A | 1 Reference(s) |
| T97FEF | Broad substrate specificity ATP-binding cassette transporter ABCG2 | ABCG2 |
Q9UNQ0 |
A | 1 Reference(s) |
| T23WX7 | Nuclear receptor coactivator 1 | NCOA1 |
Q15788 |
B | 1 Reference(s) |
| T23P74 | Caspase-9 | CASP9 |
P55211 |
B | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
B | 2 Reference(s) |
| T00EP2 | Tissue-type plasminogen activator | PLAT |
P00750 |
C | 1 Reference(s) |
| T91MKC | Runt-related transcription factor 2 | RUNX2 |
Q13950 |
C | 1 Reference(s) |
| T11BI7 | Toll-like receptor 4 | TLR4 |
O00206 |
C | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 1 Reference(s) |
| T58J2Y | Peroxisome proliferator-activated receptor gamma | PPARG |
P37231 |
C | 1 Reference(s) |
| T53AOE | Transforming growth factor beta-1 proprotein [Cleaved into: Latency-associated peptide | TGFB1 |
P01137 |
C | 1 Reference(s) |
| T25C2G | Nuclear receptor subfamily 4 group A member 1 | NR4A1 |
P22736 |
C | 1 Reference(s) |
| T75B9S | Cyclic AMP-responsive element-binding protein 1 | CREB1 |
P16220 |
C | 1 Reference(s) |
| T04SA9 | Delta(24)-sterol reductase | DHCR24 |
Q15392 |
C | 1 Reference(s) |
| T13YN2 | Bcl-2-like protein 1 | Bcl2l1 |
Q64373 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target