Compound Description
| ID: C0473 | Common name: Uridine Triphosphate |
| IUPAC: [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate | CAS: CAS:63-39-8 |
| Chembl ID: CHEMBL336296 | Pubchem ID: CID:6133 |
| Formula: C9H15N2O15P3 | TCM-ID: TCMC2211 |
| Smiles: O[C@@H]1[C@@H](COP(=O)(OP(=O)(OP(=O)(O)O)O)O)O[C@H]([C@@H]1O)n1ccc(nc1=O)O | |
| Alias:
5'-UTP;
UTP; UTP (nucleotide); Uridine 5'-triphosphate; Uridine triphosphate; Uridine, mono(tetrahydrogen triphosphate) (ester); Uteplex |
Structure:
|
Related Targets (Total: 14)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T32UPE | P2Y purinoceptor 2 | P2RY2 |
P41231 |
A | 8 Reference(s) |
| T46YMA | Ras-related C3 botulinum toxin substrate 1 | RAC1 |
P63000 |
A | 1 Reference(s) |
| T31SX8 | Bone morphogenetic protein 2 | BMP2 |
P12643 |
A | 1 Reference(s) |
| T19BO9 | Bone morphogenetic protein 4 | BMP4 |
P12644 |
A | 1 Reference(s) |
| T74M0C | Bone morphogenetic protein 5 | BMP5 |
P22003 |
A | 1 Reference(s) |
| T47DYR | P2Y purinoceptor 1 | P2RY1 |
P47900 |
A | 1 Reference(s) |
| T80GUN | 72 kDa type IV collagenase | MMP2 |
P08253 |
A | 1 Reference(s) |
| T33BFJ | P2Y purinoceptor 4 | P2RY4 |
P51582 |
A | 1 Reference(s) |
| T63Z4R | Interferon regulatory factor 9 | IRF9 |
Q00978 |
B | 1 Reference(s) |
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
C | 1 Reference(s) |
| T09H2Z | Nitric oxide synthase, inducible | NOS2 |
P35228 |
C | 1 Reference(s) |
| T10HL8 | Intercellular adhesion molecule 1 | ICAM1 |
P05362 |
C | 1 Reference(s) |
| T28ULC | NA | MIR22 |
NA |
C | 1 Reference(s) |
| T12IEI | Cadherin-2 | CDH2 |
P19022 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target