Compound Description
| ID: C0713 | Common name: Baicalein |
| IUPAC: (2S,3R,4S,5R,6S)-3,4,5-trihydroxy-6-(5-hydroxy-6-methoxy-4-oxo-2-phenylchromen-7-yl)oxyoxane-2-carboxylic acid | CAS: NA |
| Chembl ID: NA | Pubchem ID: CID:636815 |
| Formula: C22H20O11 | TCM-ID: TCMC4076 |
| Smiles: COc1c(O[C@@H]2O[C@H](C(=O)[O-])[C@@H]([C@@H]([C@H]2O)O)O)cc2c(c1O)c(=O)cc(o2)c1ccccc1 | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 25)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T87C5Q | Polyunsaturated fatty acid lipoxygenase ALOX12 | ALOX12 |
P18054 |
A | 7 Reference(s) |
| T86D6K | Polyunsaturated fatty acid lipoxygenase ALOX15 | ALOX15 |
P16050 |
A | 7 Reference(s) |
| T13KGH | Tyrosinase | TYR |
P14679 |
A | 1 Reference(s) |
| T61SU2 | Coxsackievirus and adenovirus receptor | CXADR |
P78310 |
A | 1 Reference(s) |
| T12PIB | Lysosomal alpha-glucosidase | GAA |
P10253 |
A | 1 Reference(s) |
| T48NTH | Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit delta isoform | PIK3CD |
O00329 |
A | 1 Reference(s) |
| T31JWV | Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit beta isoform | PIK3CB |
P42338 |
A | 1 Reference(s) |
| T32SPJ | Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform | PIK3CG |
P48736 |
A | 1 Reference(s) |
| T63YAO | Caveolin-1 | CAV1 |
Q03135 |
A | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
A | 2 Reference(s) |
| T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
C | 2 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 2 Reference(s) |
| T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
C | 2 Reference(s) |
| T86ROZ | Heme oxygenase 1 | HMOX1 |
P09601 |
C | 1 Reference(s) |
| T85AXP | Cytochrome P450 3A4 | CYP3A4 |
P08684 |
C | 1 Reference(s) |
| T03CZ8 | Catechol O-methyltransferase | COMT |
P21964 |
C | 1 Reference(s) |
| T50WOV | ATP-dependent translocase ABCB1 | ABCB1 |
P08183 |
C | 1 Reference(s) |
| T06Q1R | Amine oxidase [flavin-containing] B | MAOB |
P27338 |
C | 1 Reference(s) |
| T80GUN | 72 kDa type IV collagenase | MMP2 |
P08253 |
C | 1 Reference(s) |
| T49TDM | Matrix metalloproteinase-9 | MMP9 |
P14780 |
C | 1 Reference(s) |
| T43N2D | Epidermal growth factor receptor | EGFR |
P00533 |
C | 1 Reference(s) |
| T57GP2 | ETS domain-containing protein Elk-1 | ELK1 |
P19419 |
C | 1 Reference(s) |
| T20JZ2 | Androgen receptor | AR |
P10275 |
C | 1 Reference(s) |
| T68OIU | CREB-regulated transcription coactivator 1 | CRTC1 |
Q6UUV9 |
C | 1 Reference(s) |
| T22OPB | Nuclear factor erythroid 2-related factor 2 | NFE2L2 |
Q16236 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0155 | Ban Xia | 半夏 | Ternate pinellia | Pinellia ternata |
Ckey description of the interaction between compound and target