Compound Description
| ID: C0792 | Common name: Celastrol |
| IUPAC: (2R,4aS,6aS,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,14a-pentamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylic acid | CAS: NA |
| Chembl ID: NA | Pubchem ID: CID:5701992 |
| Formula: C28H36O4 | TCM-ID: TCMC5023 |
| Smiles: O=C1C=C2C(=CC=C3[C@@]2(C)CC[C@@]2([C@]3(C)CC[C@@]3([C@H]2C[C@@](C)(CC3)C(=O)[O-])C)C)C=C1O | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 23)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T88AJI | Hypoxia-inducible factor 1-alpha | HIF1A |
Q16665 |
A | 3 Reference(s) |
| T47H3O | Heat shock protein HSP 90-alpha | HSP90AA1 |
P07900 |
A | 2 Reference(s) |
| T04H8Y | Beta-secretase 1 | BACE1 |
P56817 |
A | 1 Reference(s) |
| T02QBS | Cytochrome P450 1A2 | CYP1A2 |
P05177 |
A | 1 Reference(s) |
| T06RMZ | Nuclear factor NF-kappa-B p105 subunit | NFKB1 |
P19838 |
A | 4 Reference(s) |
| T36Y8O | Fanconi anemia group D2 protein | FANCD2 |
Q9BXW9 |
A | 1 Reference(s) |
| T96OOK | Signal transducer and activator of transcription 3 | STAT3 |
P40763 |
A | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
A | 1 Reference(s) |
| T23P74 | Caspase-9 | CASP9 |
P55211 |
A | 1 Reference(s) |
| T11BI7 | Toll-like receptor 4 | TLR4 |
O00206 |
A | 2 Reference(s) |
| T67JR8 | Heat shock factor protein 1 | HSF1 |
Q00613 |
A | 1 Reference(s) |
| T18CWB | Transcriptional activator Myb | MYB |
P10242 |
A | 1 Reference(s) |
| T94DIJ | Protein CIP2A | CIP2A |
Q8TCG1 |
B | 1 Reference(s) |
| T75PC7 | NA | MIR21 |
NA |
C | 1 Reference(s) |
| T18KNE | NA | MIR146A |
NA |
C | 1 Reference(s) |
| T06DT5 | Phorbol-12-myristate-13-acetate-induced protein 1 | PMAIP1 |
Q13794 |
C | 1 Reference(s) |
| T06ADX | Tyrosine-protein kinase receptor UFO | AXL |
P30530 |
C | 1 Reference(s) |
| T04WT7 | Fibronectin | FN1 |
P02751 |
C | 1 Reference(s) |
| T15JRW | Interferon alpha-inducible protein 27, mitochondrial | IFI27 |
P40305 |
C | 1 Reference(s) |
| T20JZ2 | Androgen receptor | AR |
P10275 |
C | 1 Reference(s) |
| T33OSQ | Sterol regulatory element-binding protein 1 | SREBF1 |
P36956 |
C | 1 Reference(s) |
| T43N2D | Epidermal growth factor receptor | EGFR |
P00533 |
C | 1 Reference(s) |
| T27I35 | NA | MIR223 |
NA |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0130 | Lei Gong Teng | 雷公藤 | Common threewingnut | Tripterygium wilfordii |
Ckey description of the interaction between compound and target