| ID: C0840 | Common name: Sanguinarine |
| IUPAC: 3-hydroxy-2-methoxy-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridin-13-one | CAS: NA |
| Chembl ID: NA | Pubchem ID: CID:13855598 |
| Formula: C20H15NO5 | TCM-ID: TCMC6023 |
| Smiles: COc1cc2c(cc1O)c1ccc3c(c1n(c2=O)C)cc1c(c3)OCO1 | |
| Alias:
NA
|
Structure:
|
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T92FAW | Dual specificity protein phosphatase 1 | DUSP1 |
P28562 |
A | 4 Reference(s) |
| T96OOK | Signal transducer and activator of transcription 3 | STAT3 |
P40763 |
A | 1 Reference(s) |
| T02P7Q | Dihydrofolate reductase | DHFR |
P00374 |
A | 1 Reference(s) |
| T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
A | 1 Reference(s) |
| T81I4T | 5'-AMP-activated protein kinase catalytic subunit alpha-1 | PRKAA1 |
Q13131 |
A | 2 Reference(s) |
| T06RMZ | Nuclear factor NF-kappa-B p105 subunit | NFKB1 |
P19838 |
A | 2 Reference(s) |
| T22OPB | Nuclear factor erythroid 2-related factor 2 | NFE2L2 |
Q16236 |
A | 1 Reference(s) |
| T58XLK | Tyrosine-protein phosphatase non-receptor type 1 | PTPN1 |
P18031 |
A | 1 Reference(s) |
| T44IGL | Switch-associated protein 70 | SWAP70 |
Q9UH65 |
A | 2 Reference(s) |
| T12SOF | Eukaryotic initiation factor 4A-I | EIF4A1 |
P60842 |
A | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 1 Reference(s) |
| T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
C | 1 Reference(s) |
| T33KFW | Matrilysin | MMP7 |
P09237 |
C | 1 Reference(s) |
| T84FV7 | Zinc finger protein SNAI2 | SNAI2 |
O43623 |
C | 1 Reference(s) |
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0006 | Bai Qu Cai | 白屈菜 | Greater celandine | Chelidonium majus |