Compound Description
| ID: C1019 | Common name: Atropine |
| IUPAC: NA | CAS: CAS:51-55-8 |
| Chembl ID: CHEMBL517712 | Pubchem ID: NA |
| Formula: C17H23NO3 | TCM-ID: TCMC746 |
| Smiles: OCC(c1ccccc1)C(=O)O[C@@H]1C[C@@H]2CC[C@H](C1)N2C | |
| Alias:
1αH,5αH-Tropan-3α-ol (±)-tropate (ester);
Benzeneacetic acid, α-(hydroxymethyl)-, 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester, endo-; (3-endo)-8-Methyl-8-azabicyclo[3.2.1]oct-3-yl α-(hydroxymethyl)benzeneacetate; (±)-Atropine; (±)-Hyoscyamine; Atropin; Atropine; Atropinum sulphuricum; DL-Hyoscyamine; Tropine (±)-tropate; Tropine tropate; dl-Hyoscyamine; dl-Tropyl tropate |
Structure:
|
Related Targets (Total: 10)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T47BNM | Solute carrier family 22 member 1 | SLC22A1 |
O15245 |
A | 1 Reference(s) |
| T84WQD | Acetylcholine receptor subunit epsilon | CHRNE |
Q04844 |
A | 2 Reference(s) |
| T90SGJ | Caspase-2 | CASP2 |
P42575 |
A | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
A | 1 Reference(s) |
| T23P74 | Caspase-9 | CASP9 |
P55211 |
A | 1 Reference(s) |
| T93KNA | Muscarinic acetylcholine receptor M3 | CHRM3 |
P20309 |
A | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 1 Reference(s) |
| T13YN2 | Bcl-2-like protein 1 | Bcl2l1 |
Q64373 |
C | 1 Reference(s) |
| T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
C | 1 Reference(s) |
| T90ORW | Bcl2-associated agonist of cell death | BAD |
Q92934 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 4)
Ckey description of the interaction between compound and target