Compound Description
| ID: C1031 | Common name: sucrose |
| IUPAC: 2-[3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol | CAS: CAS:57-50-1 |
| Chembl ID: NA | Pubchem ID: CID:1115 |
| Formula: C12H22O11 | TCM-ID: TCMC7470 |
| Smiles: C(C1C(C(C(C(O1)OC2(C(C(C(O2)CO)O)O)CO)O)O)O)O | |
| Alias:
Sucrose (8CI);
(+)-Sucrose; Amerfond; Beet sugar; Cane sugar; Carrare C 10; Confectioner's sugar; D-(+)-Saccharose; D-(+)-Sucrose; D-Sucrose; Frost Sugar; GNE 410; Granulated sugar; Khandsari; Manalox AS; Microse; NSC 406942; Rock candy; Saccharose; Saccharum; Sucralox; Sucrose NF; Sugar; White sugar; alpha-D-Glucosyl-beta-D-fructofuranoside; beta-D-Fructofuranosyl alpha-D-glucopyranoside |
Structure:
|
Related Targets (Total: 18)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T01XZL | Alpha-amylase 1 | AMY1C;AMY1 |
P04745 |
A | 1 Reference(s) |
| T40JMU | Glutamine synthetase | GLUL |
P15104 |
B | 1 Reference(s) |
| T63EKR | Delta-aminolevulinic acid dehydratase | ALAD |
P13716 |
B | 1 Reference(s) |
| T33OSQ | Sterol regulatory element-binding protein 1 | SREBF1 |
P36956 |
B | 1 Reference(s) |
| T80SD7 | Sterol regulatory element-binding protein 2 | SREBF2 |
Q12772 |
B | 1 Reference(s) |
| T97XM0 | Hexokinase-1 | HK1 |
P19367 |
B | 1 Reference(s) |
| T68NCI | Aldo-keto reductase family 1 member B1 | AKR1B1 |
P15121 |
B | 1 Reference(s) |
| T81I8V | Long-chain-fatty-acid--CoA ligase 4 | ACSL4 |
O60488 |
B | 1 Reference(s) |
| T64DYJ | Lactase-phlorizin hydrolase | LCT |
P09848 |
B | 1 Reference(s) |
| T32TL1 | Sucrase-isomaltase, intestinal [Cleaved into: Sucrase | SI |
P14410 |
B | 1 Reference(s) |
| T91T8I | Glucose-6-phosphatase catalytic subunit 1 | G6PC1 |
P35575 |
C | 1 Reference(s) |
| T02QBS | Cytochrome P450 1A2 | CYP1A2 |
P05177 |
C | 1 Reference(s) |
| T41INV | Nuclear receptor subfamily 1 group I member 3 | NR1I3 |
Q14994 |
C | 1 Reference(s) |
| T63GUB | Proto-oncogene c-Fos | FOS |
P01100 |
C | 1 Reference(s) |
| T87WH7 | Fos-related antigen 2 | FOSL2 |
P15408 |
C | 1 Reference(s) |
| T43VO5 | Long-chain-fatty-acid--CoA ligase 1 | ACSL1 |
P33121 |
C | 1 Reference(s) |
| T26UPI | Collagen alpha-1(VII) chain | COL7A1 |
Q02388 |
C | 1 Reference(s) |
| T94S85 | Collagen alpha-1(I) chain | COL1A1 |
P02452 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target