| ID: C0317 | Common name: Plumbagin |
| IUPAC: 5-hydroxy-2-methylnaphthalene-1,4-dione | CAS: CAS:481-42-5 |
| Chembl ID: CHEMBL295316 | Pubchem ID: CID:10205 |
| Formula: C11H8O3 | TCM-ID: TCMC1916 |
| Smiles: CC1=CC(=O)C2=C(C1=O)C=CC=C2O | |
| Alias:
1,4-Naphthoquinone, 5-hydroxy-2-methyl-;
Plumbagin; 5-Hydroxy-2-methyl-1,4-naphthalenedione; 2-Methyl-5-hydroxy-1,4-naphthalenedione; 2-Methyl-5-hydroxy-1,4-naphthoquinone; 2-Methyljuglone; 5-Hydroxy-2-methyl-1,4-naphthoquinone; NSC 236613; NSC 688284; Plumbagine; Plumbagone |
Structure:
|
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T45G32 | Proto-oncogene tyrosine-protein kinase Src | SRC |
P12931 |
A | 1 Reference(s) |
| T22OPB | Nuclear factor erythroid 2-related factor 2 | NFE2L2 |
Q16236 |
A | 1 Reference(s) |
| T52XO3 | Cytochrome P450 2J2 | CYP2J2 |
P51589 |
A | 2 Reference(s) |
| T06RMZ | Nuclear factor NF-kappa-B p105 subunit | NFKB1 |
P19838 |
A | 2 Reference(s) |
| T80OPZ | NADPH oxidase 4 | NOX4 |
Q9NPH5 |
A | 2 Reference(s) |
| T70HTD | Cytochrome P450 2E1 | CYP2E1 |
P05181 |
A | 1 Reference(s) |
| T02QBS | Cytochrome P450 1A2 | CYP1A2 |
P05177 |
A | 1 Reference(s) |
| T29B10 | Interleukin-17A | IL17A |
Q16552 |
A | 1 Reference(s) |
| T09INZ | Transient receptor potential cation channel subfamily A member 1 | TRPA1 |
O75762 |
A | 1 Reference(s) |
| T20TB8 | NADPH oxidase 1 | NOX1 |
Q9Y5S8 |
A | 1 Reference(s) |
| T20E5P | Cytochrome b-245 heavy chain | CYBB |
P04839 |
A | 1 Reference(s) |
| T34DZ7 | Interleukin-2 | IL2 |
P60568 |
B | 1 Reference(s) |
| T50V79 | Interleukin-4 | IL4 |
P05112 |
B | 1 Reference(s) |
| T33OPP | Interleukin-6 | IL6 |
P05231 |
B | 1 Reference(s) |
| T37VLU | Interferon gamma | IFNG |
P01579 |
B | 1 Reference(s) |
| T08B2M | M-phase inducer phosphatase 1 | CDC25A |
P30304 |
B | 1 Reference(s) |
| T41SFE | Histone acetyltransferase p300 | EP300 |
Q09472 |
B | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 1 Reference(s) |
| T96OOK | Signal transducer and activator of transcription 3 | STAT3 |
P40763 |
C | 1 Reference(s) |
| T64X48 | C-X-C chemokine receptor type 4 | CXCR4 |
P61073 |
C | 2 Reference(s) |
| T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
C | 1 Reference(s) |
| T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
C | 1 Reference(s) |
| T77W6N | Thioredoxin reductase 1, cytoplasmic | TXNRD1 |
Q16881 |
C | 1 Reference(s) |