Compound Description
| ID: C0401 | Common name: Shikonin |
| IUPAC: 5,8-dihydroxy-2-[(1R)-1-hydroxy-4-methylpent-3-enyl]naphthalene-1,4-dione | CAS: CAS:517-89-5 |
| Chembl ID: CHEMBL9470 | Pubchem ID: CID:479503 |
| Formula: C16H16O5 | TCM-ID: TCMC2069 |
| Smiles: CC(=CC[C@H](C1=CC(=O)c2c(C1=O)c(O)ccc2O)O)C | |
| Alias:
1,4-Naphthalenedione, 5,8-dihydroxy-2-(1-hydroxy-4-methyl-3-pentenyl)-, (R)-;
1,4-Naphthalenedione, 5,8-dihydroxy-2-[(1R)-1-hydroxy-4-methyl-3-pentenyl]-; 1,4-Naphthoquinone, 5,8-dihydroxy-2-(1-hydroxy-4-methyl-3-pentenyl)-, (+)-; Shikonin; 5,8-Dihydroxy-2-[(1R)-1-hydroxy-4-methyl-3-penten-1-yl]-1,4-naphthalenedione; (+)-Shikonin; (R)-(+)-Shikonin; 1,4-Naphthalenedione 5,8-dihydroxy-2-[(1R)-1-hydroxy-4-methyl-3-penten-1-yl]-; C.I. 75535; Isoarnebin 4; NSC 252844; Shikonin S; Shikonine; Tokyo Violet |
Structure:
|
Related Targets (Total: 15)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T85NRC | Pyruvate kinase PKM | PKM |
P14618 |
A | 6 Reference(s) |
| T43N2D | Epidermal growth factor receptor | EGFR |
P00533 |
A | 1 Reference(s) |
| T67GDP | Aryl hydrocarbon receptor nuclear translocator-like protein 1 | ARNTL |
O00327 |
A | 1 Reference(s) |
| T46K2X | Heat shock 70 kDa protein 4 | HSPA4 |
P34932 |
A | 1 Reference(s) |
| T05TS9 | Cocaine esterase | CES2 |
O00748 |
A | 1 Reference(s) |
| T36SOV | Plasminogen activator inhibitor 1 | SERPINE1 |
P05121 |
A | 1 Reference(s) |
| T40JZG | GPI-anchor transamidase | PIGK |
Q92643 |
A | 1 Reference(s) |
| T15ZAV | Lymphocyte antigen 96 | LY96 |
Q9Y6Y9 |
B | 1 Reference(s) |
| T38OH4 | Caspase-1 | CASP1 |
P29466 |
B | 1 Reference(s) |
| T77W6N | Thioredoxin reductase 1, cytoplasmic | TXNRD1 |
Q16881 |
B | 2 Reference(s) |
| T88AJI | Hypoxia-inducible factor 1-alpha | HIF1A |
Q16665 |
B | 1 Reference(s) |
| T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
C | 1 Reference(s) |
| T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
C | 1 Reference(s) |
| T25NSJ | Mitogen-activated protein kinase 3 | MAPK3 |
P27361 |
C | 1 Reference(s) |
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 3)
Ckey description of the interaction between compound and target