ID: C0428 | Common name: Tanshinone Iia |
IUPAC: 1,6,6-trimethyl-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-10,11-dione | CAS: CAS:568-72-9 |
Chembl ID: CHEMBL187266 | Pubchem ID: CID:164676 |
Formula: C19H18O3 | TCM-ID: TCMC2127 |
Smiles: CC1=COC2=C1C(=O)C(=O)C3=C2C=CC4=C3CCCC4(C)C | |
Alias:
Tanshinone IIA;
6,7,8,9-Tetrahydro-1,6,6-trimethylphenanthro[1,2-b]furan-10,11-dione; 1,6,6-Trimethyl-6,7,8,9-tetrahydrophenanthro[1,2-b]furan-10,11-dione; 1,6,6-Trimethyl-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-10,11-dione; Dan Shen ketone; NSC 686518; NSC 686519; Salviol IIA; Tanshinon II; Tanshinone B; Tanshinone II; Tashinone IIA |
Structure: |
Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
---|---|---|---|---|---|
T26KIE | Transcription factor AP-1 | JUN |
P05412 |
A | 1 Reference(s) |
T85U8U | Caspase-3 | CASP3 |
P42574 |
A | 1 Reference(s) |
T50SX0 | Nuclear receptor subfamily 1 group I member 2 | NR1I2 |
O75469 |
A | 1 Reference(s) |
T44LWL | Transcription factor p65 | RELA |
Q04206 |
A | 1 Reference(s) |
T79KQO | NF-kappa-B inhibitor alpha | NFKBIA |
P25963 |
A | 1 Reference(s) |
T49TDM | Matrix metalloproteinase-9 | MMP9 |
P14780 |
A | 1 Reference(s) |
T53FF1 | S-phase kinase-associated protein 2 | SKP2 |
Q13309 |
A | 1 Reference(s) |
T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
A | 1 Reference(s) |
T75NEV | Aquaporin-1 | AQP1 |
P29972 |
A | 1 Reference(s) |
T29MD1 | Mitogen-activated protein kinase 8 | MAPK8 |
P45983 |
A | 2 Reference(s) |
T48YPL | Aquaporin-3 | AQP3 |
Q92482 |
A | 1 Reference(s) |
T53SLQ | Aquaporin-9 | AQP9 |
O43315 |
A | 1 Reference(s) |
T89EW0 | Aquaporin-8 | AQP8 |
O94778 |
A | 1 Reference(s) |
T11BI7 | Toll-like receptor 4 | TLR4 |
O00206 |
A | 1 Reference(s) |
T23VMI | Tumor necrosis factor | TNF |
P01375 |
A | 1 Reference(s) |
T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
A | 1 Reference(s) |
T67ZT3 | Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN | PTEN |
P60484 |
B | 1 Reference(s) |
T31SX8 | Bone morphogenetic protein 2 | BMP2 |
P12643 |
B | 1 Reference(s) |
T45G32 | Proto-oncogene tyrosine-protein kinase Src | SRC |
P12931 |
C | 1 Reference(s) |
T82G3R | Integrin beta-3 | ITGB3 |
P05106 |
C | 1 Reference(s) |
T92CLX | Calcitonin receptor | CALCR |
P30988 |
C | 1 Reference(s) |
T81I6O | Nucleophosmin | NPM1 |
P06748 |
C | 1 Reference(s) |
T02QBS | Cytochrome P450 1A2 | CYP1A2 |
P05177 |
C | 1 Reference(s) |
T63GUB | Proto-oncogene c-Fos | FOS |
P01100 |
C | 1 Reference(s) |
T85AXP | Cytochrome P450 3A4 | CYP3A4 |
P08684 |
C | 1 Reference(s) |
T64W2K | Cyclin-dependent kinase inhibitor 1 | CDKN1A |
P38936 |
C | 1 Reference(s) |
T74JJN | Fatty acid synthase | FASN |
P49327 |
C | 1 Reference(s) |
T82JWE | Cellular tumor antigen p53 | TP53 |
P04637 |
C | 1 Reference(s) |
T34E5V | Endothelin-1 receptor | EDNRA |
P25101 |
C | 1 Reference(s) |
T90ZS8 | Endothelin-converting enzyme 1 | ECE1 |
P42892 |
C | 1 Reference(s) |
T93VFT | Endothelin-1 | EDN1 |
P05305 |
C | 1 Reference(s) |
T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 2 Reference(s) |
T26EZU | Myc proto-oncogene protein | MYC |
P01106 |
C | 1 Reference(s) |
T64UH1 | Nitric oxide synthase, endothelial | NOS3 |
P29474 |
C | 1 Reference(s) |
T67LQK | Mitogen-activated protein kinase 11 (MAP kinase 11) (MAPK 11) (EC 2.7.11.24) (Mitogen-activated protein kinase p38 beta) (MAP kinase p38 beta) (p38b) (Stress-activated protein kinase 2b) (SAPK2b) (p38-2) | MAPK11 |
Q15759 |
C | 1 Reference(s) |
T71BDH | Mitogen-activated protein kinase 14 | MAPK14 |
Q16539 |
C | 1 Reference(s) |
T22OPB | Nuclear factor erythroid 2-related factor 2 | NFE2L2 |
Q16236 |
C | 1 Reference(s) |
T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
C | 1 Reference(s) |
Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
---|---|---|---|---|
H0949 | Dan Shen | 丹参 | The root of red-rooted salvia | Salvia miltiorrhiza |
H0323 | Qian Hu | 前胡 | Common hogfennel | Angelica decursiva |
H0950 | Dan Shen Gan Jin Gao | 丹参干浸膏 | The root of red-rooted salvia | Salvia miltiorrhiza |
H0951 | Dan Shen Jin Gao | 丹参浸膏 | The root of red-rooted salvia | Salvia miltiorrhiza |
H0461 | Shi Jun Zi Ren | 使君子仁 | NA | Combretum indicum |