Compound Description
| ID: C0475 | Common name: Ursodiol |
| IUPAC: (4R)-4-[(3R,5S,7S,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid | CAS: CAS:128-13-2 |
| Chembl ID: CHEMBL1551 | Pubchem ID: CID:31401 |
| Formula: C24H40O4 | TCM-ID: TCMC2215 |
| Smiles: O[C@@H]1CC[C@]2([C@@H](C1)C[C@@H]([C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2[C@@H](CCC(=O)O)C)C)O)C | |
| Alias:
5β-Cholan-24-oic acid, 3α,7β-dihydroxy-;
5β-Cholanic acid, 3α,7β-dihydroxy-; (3α,5β,7β)-3,7-Dihydroxycholan-24-oic acid; 17β-(1-Methyl-3-carboxypropyl)etiocholane-3α,7β-diol; 3α,7β-Dihydroxy-5β-cholan-24-oate; 3α,7β-Dihydroxy-5β-cholan-24-oic acid; 3α,7β-Dihydroxy-5β-cholanic acid; 3α,7β-Dihydroxy-5β-cholanoic acid; 3α,7β-Dihydroxycholanic acid; 7β-Hydroxylithocholic acid; Actigall; Adursal; Arsacol; Cholit-Ursan; Delursan; Desocol; Desol; Destolit; Deursil; Litursol; Lyeton; NSC 683769; Paptarom; Solutrat; UDCA; Urdes; Urosiol; Ursacol; Ursic acid; Urso; Ursobilin; Ursochol; Ursocholic acid, deoxy-; Ursocol; Ursodamor; Ursodeoxycholic acid; Ursodesoxycholic acid; Ursodiol; Ursofalk; Ursogall; Ursolvan; Ursosan |
Structure:
|
Related Targets (Total: 16)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T74P7I | G-protein coupled bile acid receptor 1 | GPBAR1 |
Q8TDU6 |
A | 1 Reference(s) |
| T22OPB | Nuclear factor erythroid 2-related factor 2 | NFE2L2 |
Q16236 |
A | 2 Reference(s) |
| T27M4K | Rho GTPase-activating protein 7 | DLC1 |
Q96QB1 |
A | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
A | 1 Reference(s) |
| T80PUR | Caspase-7 | CASP7 |
P55210 |
A | 1 Reference(s) |
| T38T1U | Caspase-8 | CASP8 |
Q14790 |
A | 1 Reference(s) |
| T64LKA | Bile salt export pump | ABCB11 |
O95342 |
A | 1 Reference(s) |
| T24C0P | Bile acid receptor | NR1H4 |
Q96RI1 |
A | 3 Reference(s) |
| T23P74 | Caspase-9 | CASP9 |
P55211 |
A | 1 Reference(s) |
| T94K7H | Cytochrome P450 7A1 | CYP7A1 |
P22680 |
B | 1 Reference(s) |
| T39M6J | ATP-binding cassette sub-family C member 2 | ABCC2 |
Q92887 |
C | 1 Reference(s) |
| T71BV3 | Glutathione peroxidase 1 | GPX1 |
P07203 |
C | 1 Reference(s) |
| T68VY3 | N(G),N(G)-dimethylarginine dimethylaminohydrolase 1 | DDAH1 |
O94760 |
C | 1 Reference(s) |
| T91X8E | Sterol carrier protein 2 | SCP2 |
P22307 |
C | 1 Reference(s) |
| T44ISH | Transcription factor MafG | MAFG |
O15525 |
C | 1 Reference(s) |
| T97FEF | Broad substrate specificity ATP-binding cassette transporter ABCG2 | ABCG2 |
Q9UNQ0 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 4)
Ckey description of the interaction between compound and target