Compound Description
| ID: C0590 | Common name: Α-Elemene,Β-Elemene |
| IUPAC: 1-ethenyl-1-methyl-2,4-bis(prop-1-en-2-yl)cyclohexane | CAS: NA |
| Chembl ID: NA | Pubchem ID: CID:10583 |
| Formula: C15H24 | TCM-ID: TCMC3013 |
| Smiles: CC(=C)C1CCC(C(C1)C(=C)C)(C)C=C | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 17)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T64T4I | Telomerase protein component 1 | TEP1 |
Q99973 |
A | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
A | 1 Reference(s) |
| T88AJI | Hypoxia-inducible factor 1-alpha | HIF1A |
Q16665 |
A | 1 Reference(s) |
| T11GHO | Transforming protein RhoA | RHOA |
P61586 |
C | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 1 Reference(s) |
| T29JZ3 | Vascular endothelial growth factor receptor 3 | FLT4 |
P35916 |
C | 1 Reference(s) |
| T93W1J | Vascular endothelial growth factor C | VEGFC |
P49767 |
C | 1 Reference(s) |
| T57WWD | Eukaryotic translation initiation factor 4 gamma 1 | EIF4G1 |
Q04637 |
C | 1 Reference(s) |
| T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
C | 1 Reference(s) |
| T88QQE | Fibroblast growth factor 2 | FGF2 |
P09038 |
C | 1 Reference(s) |
| T77A47 | Eukaryotic translation initiation factor 4E | EIF4E |
P06730 |
C | 1 Reference(s) |
| T07TMB | Cyclin-dependent kinase 1 | CDK1 |
P06493 |
C | 1 Reference(s) |
| T24LXT | G2/mitotic-specific cyclin-B1 | CCNB1 |
P14635 |
C | 1 Reference(s) |
| T82JWE | Cellular tumor antigen p53 | TP53 |
P04637 |
C | 1 Reference(s) |
| T67LQK | Mitogen-activated protein kinase 11 (MAP kinase 11) (MAPK 11) (EC 2.7.11.24) (Mitogen-activated protein kinase p38 beta) (MAP kinase p38 beta) (p38b) (Stress-activated protein kinase 2b) (SAPK2b) (p38-2) | MAPK11 |
Q15759 |
C | 1 Reference(s) |
| T02IOG | Cyclin-dependent kinase inhibitor 1B | CDKN1B |
P46527 |
C | 1 Reference(s) |
| T64W2K | Cyclin-dependent kinase inhibitor 1 | CDKN1A |
P38936 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target