Compound Description
| ID: C0617 | Common name: Coptisine |
| IUPAC: 5,7,17,19-tetraoxa-13-azoniahexacyclo[11.11.0.02,10.04,8.015,23.016,20]tetracosa-1(13),2,4(8),9,14,16(20),21,23-octaene | CAS: NA |
| Chembl ID: CHEMBL362071 | Pubchem ID: CID:72322 |
| Formula: C19H14NO4 | TCM-ID: TCMC3238 |
| Smiles: C1C[N+]2=C(C=C3C=CC4=C(C3=C2)OCO4)C5=CC6=C(C=C51)OCO6 | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 7)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T38OH4 | Caspase-1 | CASP1 |
P29466 |
A | 1 Reference(s) |
| T68XO1 | Indoleamine 2,3-dioxygenase 1 | IDO1 |
P14902 |
A | 2 Reference(s) |
| T14V9R | Dihydroorotate dehydrogenase | DHODH |
Q02127 |
A | 1 Reference(s) |
| T21DZX | Amine oxidase [flavin-containing] A | MAOA |
P21397 |
B | 1 Reference(s) |
| T49TDM | Matrix metalloproteinase-9 | MMP9 |
P14780 |
C | 1 Reference(s) |
| T31P1D | Metalloproteinase inhibitor 1 | TIMP1 |
P01033 |
C | 1 Reference(s) |
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 3)
Ckey description of the interaction between compound and target