Compound Description
| ID: C0700 | Common name: Ginsenoside Rg1 |
| IUPAC: (2R,3R,4S,5S,6R)-2-[[(3S,5R,6S,8R,9R,10R,12R,13R,14R,17S)-3,12-dihydroxy-4,4,8,10,14-pentamethyl-17-[(2S)-6-methyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhept-5-en-2-yl]-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol | CAS: CAS:22427-39-0 |
| Chembl ID: CHEMBL501637 | Pubchem ID: CID:441923 |
| Formula: C42H72O14 | TCM-ID: TCMC3859 |
| Smiles: CC(=CCCC(C)(C1CCC2(C1C(CC3C2(CC(C4C3(CCC(C4(C)C)O)C)OC5C(C(C(C(O5)CO)O)O)O)C)O)C)OC6C(C(C(C(O6)CO)O)O)O)C | |
| Alias:
Ginsenoside Rg1;
Panaxoside A; (3β,6α,12β)-3,12-Dihydroxydammar-24-ene-6,20-diyl bis-β-D-glucopyranoside; Dammarane, β-D-glucopyranoside deriv.; Ginsenoside A2; Ginsenoside g1; Panaxoside Rg1; Panaxsaponin Rg1; Sanchinoside C1; Sanchinoside Rg1 |
Structure:
|
Related Targets (Total: 23)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T84W8G | Aryl hydrocarbon receptor | AHR |
P35869 |
A | 1 Reference(s) |
| T67KTV | Transient receptor potential cation channel subfamily V member 1 | TRPV1 |
Q8NER1 |
A | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
A | 2 Reference(s) |
| T83YZD | Acetylcholinesterase | ACHE |
P22303 |
A | 1 Reference(s) |
| T47G3X | Glucocorticoid receptor | NR3C1 |
P04150 |
A | 1 Reference(s) |
| T04WT7 | Fibronectin | FN1 |
P02751 |
C | 1 Reference(s) |
| T94S85 | Collagen alpha-1(I) chain | COL1A1 |
P02452 |
C | 1 Reference(s) |
| T34DZ7 | Interleukin-2 | IL2 |
P60568 |
C | 1 Reference(s) |
| T50V79 | Interleukin-4 | IL4 |
P05112 |
C | 1 Reference(s) |
| T00T9M | Thrombospondin-1 | THBS1 |
P07996 |
C | 1 Reference(s) |
| T53AOE | Transforming growth factor beta-1 proprotein [Cleaved into: Latency-associated peptide | TGFB1 |
P01137 |
C | 1 Reference(s) |
| T61J7T | Mothers against decapentaplegic homolog 2 | SMAD2 |
Q15796 |
C | 1 Reference(s) |
| T94H37 | Cadherin-1 | CDH1 |
P12830 |
C | 1 Reference(s) |
| T63BQU | Cytochrome P450 1A1 | CYP1A1 |
P04798 |
C | 1 Reference(s) |
| T25H22 | Protein kinase C beta type | PRKCB |
P05771 |
C | 1 Reference(s) |
| T82JWE | Cellular tumor antigen p53 | TP53 |
P04637 |
C | 1 Reference(s) |
| T93LMN | Microtubule-associated protein tau | MAPT |
P10636 |
C | 1 Reference(s) |
| T25YP8 | Aquaporin-4 | AQP4 |
P55087 |
C | 1 Reference(s) |
| T64BTV | Interleukin-1 beta | IL1B |
P01584 |
C | 1 Reference(s) |
| T17CNB | Thioredoxin | TXN |
P10599 |
C | 1 Reference(s) |
| T49TDM | Matrix metalloproteinase-9 | MMP9 |
P14780 |
C | 1 Reference(s) |
| T88AJI | Hypoxia-inducible factor 1-alpha | HIF1A |
Q16665 |
C | 1 Reference(s) |
| T12T4H | Brain-derived neurotrophic factor | BDNF |
P23560 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 3)
Ckey description of the interaction between compound and target