Compound Description
| ID: C0907 | Common name: Angiotensin Ii |
| IUPAC: (3S)-3-amino-4-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S,3S)-1-[[(2S)-1-[(2S)-2-[[(1S)-1-carboxy-2-phenylethyl]carbamoyl]pyrrolidin-1-yl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]-3-methyl-1-oxopentan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-oxobutanoic acid | CAS: NA |
| Chembl ID: CHEMBL408403 | Pubchem ID: CID:172198 |
| Formula: C50H71N13O12 | TCM-ID: TCMC698 |
| Smiles: CC[C@@H]([C@@H](C(=N[C@H](C(=O)N1CCC[C@H]1C(=N[C@H](C(=O)O)Cc1ccccc1)O)Cc1[nH]cnc1)O)N=C([C@@H](N=C([C@H](C(C)C)N=C([C@@H](N=C([C@H](CC(=O)O)N)O)CCCNC(=N)N)O)O)Cc1ccc(cc1)O)O)C | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 19)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T64F54 | Mineralocorticoid receptor | NR3C2 |
P08235 |
A | 1 Reference(s) |
| T16UZ4 | Dipeptidyl peptidase 4 | DPP4 |
P27487 |
A | 1 Reference(s) |
| T23RWU | Type-1 angiotensin II receptor | AGTR1 |
P30556 |
A | 2 Reference(s) |
| T73SYQ | Mas-related G-protein coupled receptor member X3 | MRGPRX3 |
Q96LB0 |
A | 1 Reference(s) |
| T96OOK | Signal transducer and activator of transcription 3 | STAT3 |
P40763 |
B | 1 Reference(s) |
| T32W5X | Type-2 angiotensin II receptor | AGTR2 |
P50052 |
B | 1 Reference(s) |
| T11B42 | MAP kinase-activated protein kinase 2 | MAPKAPK2 |
P49137 |
C | 1 Reference(s) |
| T25NSJ | Mitogen-activated protein kinase 3 | MAPK3 |
P27361 |
C | 1 Reference(s) |
| T62P0D | Collagenase 3 | MMP13 |
P45452 |
C | 1 Reference(s) |
| T53Z7Y | Transcriptional coactivator YAP1 | YAP1 |
P46937 |
C | 1 Reference(s) |
| T80GUN | 72 kDa type IV collagenase | MMP2 |
P08253 |
C | 1 Reference(s) |
| T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
C | 1 Reference(s) |
| T82P0Z | Renin | REN |
P00797 |
C | 1 Reference(s) |
| T53AOE | Transforming growth factor beta-1 proprotein [Cleaved into: Latency-associated peptide | TGFB1 |
P01137 |
C | 1 Reference(s) |
| T40YHI | Tumor necrosis factor receptor superfamily member 12A | TNFRSF12A |
Q9NP84 |
C | 1 Reference(s) |
| T44LWL | Transcription factor p65 | RELA |
Q04206 |
C | 1 Reference(s) |
| T51DHZ | Protein C-ets-1 | ETS1 |
P14921 |
C | 1 Reference(s) |
| T64ZHK | Type-1 angiotensin II receptor-associated protein | AGTRAP |
Q6RW13 |
C | 1 Reference(s) |
| T17FIA | Angiotensinogen | AGT |
P01019 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target